| Company Name: |
Amadis Chemical Company Limited |
| Tel: |
571-89925085 |
| Email: |
sales@amadischem.com |
| Products Intro: |
Product Name:3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-pentacosafluoro-1-tetradecene
CAS:67103-05-3
Purity:0.97 Package:mgs,gs,kgs Remarks:A835631
|
|
|
|
|
|
| | (Perfluorododecyl)ethylene Basic information |
| Product Name: | (Perfluorododecyl)ethylene | | Synonyms: | 1H,1H,2H-PERFLUORO-1-TETRADECENE;1H,1H,2H-Perfluoro-1-tetradecene97%;(Perfluorododecyl)ethylene;1H,1H,2H-Perfluorotetradec-1-ene 97%;(Perfluorododecyl)ethylene, tech;1H,1H,2H-Pentacosafluorotetradec-1-ene 97%;3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-Pentacosafluorotetradec-1-ene, (Perfluorododec-1-yl)ethylene;1H,1H,2H-Pentacosafluorotetradec-1-ene97% | | CAS: | 67103-05-3 | | MF: | C14H3F25 | | MW: | 646.13 | | EINECS: | | | Product Categories: | | | Mol File: | 67103-05-3.mol |  |
| | (Perfluorododecyl)ethylene Chemical Properties |
| Melting point | 61-62 | | Boiling point | 118-120/20mm | | density | 1.650±0.06 g/cm3(Predicted) | | form | Solid | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | InChI | 1S/C14H3F25/c1-2-3(15,16)4(17,18)5(19,20)6(21,22)7(23,24)8(25,26)9(27,28)10(29,30)11(31,32)12(33,34)13(35,36)14(37,38)39/h2H,1H2 | | InChIKey | CAAQNKVBCKOIAP-UHFFFAOYSA-N | | SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C=C | | EPA Substance Registry System | (Perfluorododecyl)ethylene (67103-05-3) |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2903590090 | | Storage Class | 11 - Combustible Solids |
| | (Perfluorododecyl)ethylene Usage And Synthesis |
| | (Perfluorododecyl)ethylene Preparation Products And Raw materials |
|