- Dibenzyl oxylate
-
- $0.00 / 200kg
-
2026-03-20
- CAS:7579-36-4
- Min. Order: 20kg
- Purity: 99%
- Supply Ability: 20 tons
- Dibenzyl oxalate
-
- $1.00 / 1kg
-
2025-06-20
- CAS:7579-36-4
- Min. Order: 1kg
- Purity: 98.0%（HPLC）
- Supply Ability: 20tons
- Dibenzyl oxalate
-
- $40.00/ kg
-
2025-04-15
- CAS:7579-36-4
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 5000kg/week
|
| | Dibenzyl oxalate Basic information |
| Product Name: | Dibenzyl oxalate | | Synonyms: | DIBENZYL OXALATE;Ethanedioic acid bis(phenylmethyl) ester;oxalic acid dibenzyl ester;Ethanedioic acid,1,2-bis(phenylmethyl) ester;Dibenzyl oxylate;Benzyl oxalate;Dibenzyl oxalate,97%;Dibenzyl oxalate 98% | | CAS: | 7579-36-4 | | MF: | C16H14O4 | | MW: | 270.28 | | EINECS: | 411-720-3 | | Product Categories: | C12 to C63;Carbonyl Compounds;Esters | | Mol File: | 7579-36-4.mol |  |
| | Dibenzyl oxalate Chemical Properties |
| Melting point | 80-82 °C (lit.) | | Boiling point | 235 °C/14 mmHg (lit.) | | density | 1.212 | | refractive index | 1.5447 (estimate) | | Fp | 171°C | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C16H14O4/c17-15(19-11-13-7-3-1-4-8-13)16(18)20-12-14-9-5-2-6-10-14/h1-10H,11-12H2 | | InChIKey | ZYZXGWGQYNTGAU-UHFFFAOYSA-N | | SMILES | C(OCC1=CC=CC=C1)(=O)C(OCC1=CC=CC=C1)=O | | CAS DataBase Reference | 7579-36-4 | | NIST Chemistry Reference | Ethanedioic acid, bis(phenylmethyl) ester(7579-36-4) | | EPA Substance Registry System | Ethanedioic acid, bis(phenylmethyl) ester (7579-36-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29171100 | | Storage Class | 11 - Combustible Solids |
| | Dibenzyl oxalate Usage And Synthesis |
| Chemical Properties | White flaked crystalline solid | | Uses | Dibenzyl Oxalate is sensitizer; used in method for preparing composite color-changing temperature fiber. |
| | Dibenzyl oxalate Preparation Products And Raw materials |
|