- Dibenzyl phosphate
-
- $10.00 / 1KG
-
2025-10-21
- CAS:1623-08-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
- Dibenzyl phosphate
-
- $0.00 / 25KG
-
2025-09-16
- CAS:1623-08-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 50000KG/month
- Dibenzyl phosphate
-
- $0.00 / 1KG
-
2025-06-27
- CAS:1623-08-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
|
| | Dibenzyl phosphate Basic information |
| | Dibenzyl phosphate Chemical Properties |
| Melting point | 78-80 °C (lit.) | | Boiling point | 427.6±48.0 °C(Predicted) | | density | 1.280±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly, Heated), Methanol (Slightly) | | form | Powder | | pka | 1.53±0.50(Predicted) | | color | White to slightly yellow | | BRN | 2055755 | | Stability: | Moisture Sensitive | | InChI | InChI=1S/C14H15O4P/c15-19(16,17-11-13-7-3-1-4-8-13)18-12-14-9-5-2-6-10-14/h1-10H,11-12H2,(H,15,16) | | InChIKey | HDFFVHSMHLDSLO-UHFFFAOYSA-N | | SMILES | P(O)(OCC1=CC=CC=C1)(OCC1=CC=CC=C1)=O | | CAS DataBase Reference | 1623-08-1(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 29199000 |
| | Dibenzyl phosphate Usage And Synthesis |
| Chemical Properties | white to slightly yellow powder | | Uses | Eye irritant. | | Uses | Dibenzyl phosphate (DBzP) can be used:
- To promote the monoselective ortho-C-H alkylation of N-quinolyl benzamides with primary and secondary alkyl iodides.
- For the ring-opening reaction of epoxide such as benzylglycidol to synthesize dihydroxyacetone phosphate (DHAP).
- As a reactant for the synthesis of stereospecific 1,2-trans glycosyl phosphates.
| | Definition | ChEBI: Dibenzyl phosphate is a dialkyl phosphate. |
| | Dibenzyl phosphate Preparation Products And Raw materials |
|