- PACHYCARPINE
-
- $1.00
-
2026-08-07
- CAS:492-08-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 9000KG
- (+)-Sparteine
-
-
2026-07-17
- CAS:492-08-0
- Purity: 99.90%
- Supply Ability: 10g
- (+)-Sparteine
-
- $400.00
-
2024-02-08
- CAS:492-08-0
- Min. Order: 1g
- Purity: 98
- Supply Ability: 50 Kg
|
| | PACHYCARPINE Basic information |
| Product Name: | PACHYCARPINE | | Synonyms: | PACHYCARPINE;d-Sparteine;Sparteine d-isomer;(7R,7aR,14R,14aS)-Dodecahydro-7,14-methano-2H,6H-dipyrido[1,2-a:1',2'-e][1,5]diazocine;(+)-Sparteine, 98%, from Parochetus communis D. Don;(1R,2S,9R,10R)-7,15-Diazatetracyclo[7.7.1.02,7.010,15]heptadecane;(7R)-1,3,4,7,7aβ,8,9,10,11,13,14,14aα-Dodecahydro-7β,14β-methano-2H,6H-dipyrido[1,2-a:1',2'-e][1,5]diazocine;7,14-Methano-2H,6H-dipyrido[1,2-a:1',2'-e][1,5]diazocine, dodecahydro-, (7R,7aR,14R,14aS)- | | CAS: | 492-08-0 | | MF: | C15H26N2 | | MW: | 234.38 | | EINECS: | 805-899-0 | | Product Categories: | | | Mol File: | 492-08-0.mol |  |
| | PACHYCARPINE Chemical Properties |
| Melting point | 201℃ | | Boiling point | 174°C/8mmHg(lit.) | | density | 1.08 | | refractive index | n/D1.527 | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform (slightly), Ethanol | | form | liquid | | pka | 10.08±0.20(Predicted) | | color | Colourless to Light Yellow | | λmax | 202nm(CH3CN)(lit.) | | InChI | InChI=1S/C15H26N2/c1-3-7-16-11-13-9-12(14(16)5-1)10-17-8-4-2-6-15(13)17/h12-15H,1-11H2/t12-,13-,14-,15+/m1/s1 | | InChIKey | SLRCCWJSBJZJBV-TUVASFSCSA-N | | SMILES | N12CCCC[C@@]1([H])[C@]1([H])C[C@]([H])(C2)[C@@]2([H])CCCCN2C1 | | CAS DataBase Reference | 492-08-0 |
| WGK Germany | WGK 3 | | RTECS | RT0620000 | | HS Code | 2933998090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral | | Toxicity | LD50 scu-mus: 90 mg/kg FATOAO 21(5),46,58 |
| | PACHYCARPINE Usage And Synthesis |
| Uses | (+)-Sparteine is a natural alkaloid acting as a ganglionic blocking agent. (+)-Sparteine competitively blocks nicotinic ACh receptor in the neurons. | | Safety Profile | Poison by subcutaneous and intravenous routes. When heated to decomposition it emits toxic fumes of NOx. | | References | [1] Voitenko S, et al. Effect of (+)-sparteine on nicotinic acetylcholine receptors in the neurons of rat superior cervical ganglion. Mol Pharmacol. 1991 Aug;40(2):180-5. PMID:1715014 |
| | PACHYCARPINE Preparation Products And Raw materials |
|