| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Aminobenzophenone-2'-carboxylic acid Basic information |
| Product Name: | 2-Aminobenzophenone-2'-carboxylic acid | | Synonyms: | 2-(2-AMINOBENZOYL)BENZOIC ACID;2-ANTHRANILOYLBENZOIC ACID;2-AMINOBENZOPHENONE-2''-CARBOXYLIC ACID (KG LEVEL);2-(2-Aminobenzoyl)benzoic acid, 2-Anthraniloylbenzoic acid;TIMTEC-BB SBB003209;2-Aminobenzophenone-2'-carboxylic acid,99%;2-Aminobenzophenone-2'-carboxylic acid 98%;2'-Aminobenzophenone-2-carboxylic Acid > | | CAS: | 1147-43-9 | | MF: | C14H11NO3 | | MW: | 241.24 | | EINECS: | 214-554-8 | | Product Categories: | | | Mol File: | 1147-43-9.mol |  |
| | 2-Aminobenzophenone-2'-carboxylic acid Chemical Properties |
| Melting point | 196-199 °C (dec.)(lit.) | | Boiling point | 520.9±35.0 °C(Predicted) | | density | 1.322±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 3.28±0.36(Predicted) | | color | Light yellow to Yellow to Green | | Major Application | peptide synthesis | | InChI | 1S/C14H11NO3/c15-12-8-4-3-7-11(12)13(16)9-5-1-2-6-10(9)14(17)18/h1-8H,15H2,(H,17,18) | | InChIKey | KORKIRUGUNPQML-UHFFFAOYSA-N | | SMILES | Nc1ccccc1C(=O)c2ccccc2C(O)=O | | CAS DataBase Reference | 1147-43-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29224985 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-Aminobenzophenone-2'-carboxylic acid Usage And Synthesis |
| Chemical Properties | yellow crystalline powder | | Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | 2-Aminobenzophenone-2'-carboxylic acid Preparation Products And Raw materials |
|