| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Pentafluoro[(triisopropylsilyl)ethynyl]sulfur Basic information |
| Product Name: | Pentafluoro[(triisopropylsilyl)ethynyl]sulfur | | Synonyms: | [(Triisopropylsilyl)acetylene]sulfur pentafluoride;Pentafluoro[(triisopropylsilyl)ethynyl]sulfur;butyl-[2-(pentafluoro-$l^{6}-sulfanyl)ethynyl]-dipropylsilane;Sulfur, pentafluoro[2-[tris(1-methylethyl)silyl]ethynyl]-, (OC-6-21)- | | CAS: | 474668-34-3 | | MF: | C11H21F5SSi | | MW: | 308.43 | | EINECS: | | | Product Categories: | | | Mol File: | 474668-34-3.mol | ![Pentafluoro[(triisopropylsilyl)ethynyl]sulfur Structure](CAS/GIF/474668-34-3.gif) |
| | Pentafluoro[(triisopropylsilyl)ethynyl]sulfur Chemical Properties |
| density | 1.076 g/mL at 25 °C | | refractive index | n20/D 1.414 | | form | liquid | | InChI | 1S/C11H21F5SSi/c1-9(2)18(10(3)4,11(5)6)8-7-17(12,13,14,15)16/h9-11H,1-6H3 | | InChIKey | OHFCQWVMVRPEHF-UHFFFAOYSA-N | | SMILES | CC(C)[Si](C#CS(F)(F)(F)(F)F)(C(C)C)C(C)C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | WGK 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Pentafluoro[(triisopropylsilyl)ethynyl]sulfur Usage And Synthesis |
| | Pentafluoro[(triisopropylsilyl)ethynyl]sulfur Preparation Products And Raw materials |
|