|
|
| | (Triisopropylsilyl)acetylene Basic information |
| | (Triisopropylsilyl)acetylene Chemical Properties |
| Melting point | 50-51 °C | | Boiling point | 50-52 °C/0.6 mmHg (lit.) | | density | 0.813 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.4527(lit.) | | Fp | 133 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Miscible with organic solvents. | | form | liquid | | Specific Gravity | 0.813 | | color | Clear, colourless | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | BRN | 3536241 | | InChI | InChI=1S/C11H22Si/c1-8-12(9(2)3,10(4)5)11(6)7/h1,9-11H,2-7H3 | | InChIKey | KZGWPHUWNWRTEP-UHFFFAOYSA-N | | SMILES | [Si](C#C)(C(C)C)(C(C)C)C(C)C | | CAS DataBase Reference | 89343-06-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39-37/39 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | TSCA | N | | HazardClass | 3.2 | | PackingGroup | III | | HS Code | 29319090 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| | (Triisopropylsilyl)acetylene Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Physical properties | colorless clear liquid; bp 50–52 °C at 0.8 hPa
(0.6 mmHg), flash point 56 °C (closed cup); d = 0.813. | | Uses | (Triisopropylsilyl)acetylene may be used as reagent for the rhodium-catalyzed asymmetric alkynylation of various α,β-unsaturated ketones. It may be used as reagent in the enantioselective synthesis of β-alkynylated nitroalkanes. | | Uses | (Triisopropylsilyl)acetylene (TIPS-acetylene) is an
easily handled and inexpensive monoprotected acetylene used
as an attractive substitute for trimethylsilylacetylene (TMSacetylene).
The bulkier silyl protecting group of TIPS-acetylene
provides stability in a wider range of reaction conditions than
TMS-acetylene. Its higher boiling point also provides better handling
and safety than TMS-acetylene (bp 87–88°C at 12 hPa
(9 mmHg)). The general utility of TIPS-acetylene is often highlighted
in the transition metal-catalyzed C–C bond formations, including but not limited to transition metal-catalyzed Coupling Reactions;Reaction of TIPS-acetylide with Electrophiles;Synthesis of Polyynes;Transition Metal-catalyzed Cross-addition of TIPSacetylene
to Alkynes;Hydroalkynylation;Direct Alkynylation;Conjugate Addition;Cycloaddition;Ring-opening Reactions etc. | | Application | (Triisopropylsilyl)acetylene is often used in palladium-catalyzed Sonogashira coupling reactions to react with aryl halides to generate terminal alkynes. This reaction has good functional group compatibility and is suitable for later modification of drug molecules. It can be used for rhodium-catalyzed asymmetric alkynylation of α,β-unsaturated ketones to generate products with high stereoselectivity. | | General Description | Asymmetric addition of (triisopropylsilyl)acetylene to α,β,γ,δ-unsaturated carbonyl compounds in the presence of a cobalt/Duphos catalyst is reported. A Sonogashira coupling reaction between 1-bromo-3-iodo-5-tertbutylbenzene and (triisopropylsilyl)acetylene is reported. | | Synthesis | Triisopropylsilylacetylene can be prepared by a one-step reaction of triisopropylsilyl bromide with acetylene gas. | | storage |
(Triisopropylsilyl)acetylene (Ethynyltriisopropylsilane) is stable to air and moisture, incompatible with strong acids, bases, or oxidants, and flammable vapor and liquid. Skin/eye contact and inhalation should be avoided.
|
| | (Triisopropylsilyl)acetylene Preparation Products And Raw materials |
| Preparation Products | 5-Ethynylisophthalic acid-->4-ETHYNYLBENZYL ALCOHOL 97-->(3-(1-(triisopropylsilyl)-5-(triMethylsilyl) penta-1,4-diyn-3-ylidene)penta-1,4-diyne- 1,5-diyl)bis(triisopropylsilane)-->TIPS-anthracene-->(3-(dibroMoMethylene)-5-(triisopropylsilyl) penta-1,4-diynyl)triMethylsilane-->1,3-Cyclopentadiene-1,3-dicarboxylic acid, 2,4-dimethyl-5-[[tris(1-methylethyl)silyl]methylene]-, 1,3-diethyl ester |
|