1H-Pyrrole-2,5-dicarboxylic acid manufacturers
- Irbinitinib
-
- $2.00
-
2026-08-25
- CAS:937-27-9
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
|
| | 1H-Pyrrole-2,5-dicarboxylic acid Basic information |
| | 1H-Pyrrole-2,5-dicarboxylic acid Chemical Properties |
| Melting point | 265 °C (decomp) | | Boiling point | 528.2±35.0 °C(Predicted) | | density | 1.671±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 3.47±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C6H5NO4/c8-5(9)3-1-2-4(7-3)6(10)11/h1-2,7H,(H,8,9)(H,10,11) | | InChIKey | JLUIOEOHOOLSJC-UHFFFAOYSA-N | | SMILES | N1C(C(O)=O)=CC=C1C(O)=O |
| | 1H-Pyrrole-2,5-dicarboxylic acid Usage And Synthesis |
| Uses | 1H-Pyrrole-2,5-dicarboxylic acid is used as a ligand in the synthesis of MOF materials: KMF-1(Al). | | Definition | ChEBI: Pyrrole-2,5-dicarboxylic acid is a pyrroledicarboxylic acid in which the two carboxy groups are located at positions 2 and 5. It has a role as a metabolite. |
| | 1H-Pyrrole-2,5-dicarboxylic acid Preparation Products And Raw materials |
| Raw materials | 1H-Pyrrole-1,2,5-tricarboxylic acid, 1-(1,1-dimethylethyl) 2,5-dimethyl ester-->2,4-Hexadienedioic acid, 2,5-dihydroxy-, diethyl ester-->Methyl 2-pyrrolecarboxylate-->1H-Pyrrole-2,5-dicarboxylic acid, monomethyl ester-->5-Formylpyrrole-2-carboxylic acid methyl ester-->2-(Trichloroacetyl)pyrrole-->2,5-Dimethyl-1H-pyrrole | | Preparation Products | Pyrrole-2,5-dicarboxaldehyde-->Pyrrole |
|