|
|
| | 1H-Pyrrole-2,5-dicarboxylic acid, monomethyl ester Basic information |
| Product Name: | 1H-Pyrrole-2,5-dicarboxylic acid, monomethyl ester | | Synonyms: | 1H-Pyrrole-2,5-dicarboxylic acid, monomethyl ester;5-(Methoxycarbonyl)-1H-pyrrole-2-carboxylic acid;1H-Pyrrole-2,5-dicarboxylic acid, 2-methyl ester;5-(methoxycarbonyl)-1H-pyrrole-2-carboxylic acid - [AC77642] | | CAS: | 1199-64-0 | | MF: | C7H7NO4 | | MW: | 169.13 | | EINECS: | | | Product Categories: | | | Mol File: | 1199-64-0.mol |  |
| | 1H-Pyrrole-2,5-dicarboxylic acid, monomethyl ester Chemical Properties |
| Melting point | 241-242 °C | | Boiling point | 408.6±30.0 °C(Predicted) | | density | 1.431±0.06 g/cm3(Predicted) | | pka | 3.75±0.10(Predicted) | | InChI | InChI=1S/C7H7NO4/c1-12-7(11)5-3-2-4(8-5)6(9)10/h2-3,8H,1H3,(H,9,10) | | InChIKey | RSCFOPAKJCCZNX-UHFFFAOYSA-N | | SMILES | N1C(C(O)=O)=CC=C1C(OC)=O |
| | 1H-Pyrrole-2,5-dicarboxylic acid, monomethyl ester Usage And Synthesis |
| | 1H-Pyrrole-2,5-dicarboxylic acid, monomethyl ester Preparation Products And Raw materials |
|