| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Allyltris(trimethylsiloxy)silane Basic information |
| Product Name: | Allyltris(trimethylsiloxy)silane | | Synonyms: | Allyltris(trimethylsilyloxy)silane;Trisiloxane, 1,1,1,5,5,5-hexamethyl-3-(2-propen-1-yl)-3-[(trimethylsilyl)oxy]-;Allyltris(trimethylsilyloxy)silane >;3-Allyl-1,1,1,5,5,5-hexamethyl-3-((trimethylsilyl)oxy)trisiloxane;Allyltris(trimethylsiloxy)silane | | CAS: | 7087-21-0 | | MF: | C12H32O3Si4 | | MW: | 336.72 | | EINECS: | | | Product Categories: | monomer;Si (Classes of Silicon Compounds);Siloxanes;Si-O Compounds;Vinylsilanes, Allylsilanes | | Mol File: | 7087-21-0.mol |  |
| | Allyltris(trimethylsiloxy)silane Chemical Properties |
| Melting point | <0°C | | Boiling point | 105 °C | | density | 0.86 | | refractive index | 1.4008 | | Fp | 153°C | | storage temp. | 2-8°C, stored under nitrogen | | Water Solubility | Insoluble in water | | form | clear liquid | | color | Colorless to Almost colorless | | Specific Gravity | 0.86 | | Hydrolytic Sensitivity | 2: reacts with aqueous acid | | InChI | InChI=1S/C12H32O3Si4/c1-11-12-19(13-16(2,3)4,14-17(5,6)7)15-18(8,9)10/h11H,1,12H2,2-10H3 | | InChIKey | WCAXVXQTTCIZHD-UHFFFAOYSA-N | | SMILES | [Si](C)(C)(C)O[Si](CC=C)(O[Si](C)(C)C)O[Si](C)(C)C | | CAS DataBase Reference | 7087-21-0 |
| | Allyltris(trimethylsiloxy)silane Usage And Synthesis |
| | Allyltris(trimethylsiloxy)silane Preparation Products And Raw materials |
|