S(-)-VERAPAMIL manufacturers
|
| | S(-)-VERAPAMIL Basic information |
| Product Name: | S(-)-VERAPAMIL | | Synonyms: | S(-)-VERAPAMIL;S(-)-VERAPAMIL HYDROCHLORIDE;S-Verapamil HCL;[7-cyano-1,7-bis(3,4-dimethoxyphenyl)nonan-3-yl]ammonium chloride;(-)-[3-cyano-3-(3,4-dimethoxyphenyl)hex-6-yl][2-(3,4-dimethoxyphenyl)ethyl]methylammonium chloride;S(-)-VERAPAMIL HYDROCHLORIDE HYDRATE;Benzeneacetonitrile, a-[3-[[2-(3,4-dimethoxyphenyl)ethyl]methylamino]propyl]-3,4-dimethoxy-a-(1-methylethyl)-, monohydrochloride, (aS)- (9CI);Benzeneacetonitrile, a-[3-[[2-(3,4-dimethoxyphenyl)ethyl]methylamino]propyl]-3,4-dimethoxy-a-(1-methylethyl)-, monohydrochloride, (S)- | | CAS: | 36622-28-3 | | MF: | C27H38N2O4 | | MW: | 454.6 | | EINECS: | 253-132-8 | | Product Categories: | Calcium Channel Modulators;Verapamil;Voltage-gated Ion Channels;Organics | | Mol File: | 36622-28-3.mol |  |
| | S(-)-VERAPAMIL Chemical Properties |
| Melting point | 131-133 °C | | solubility | H2O: >30 mg/mL | | form | solid | | color | white | | Optical Rotation | [α]22/D 6.1°, c = 0.1 in ethanol(lit.) | | Water Solubility | H2O: >30mg/mL ethanol: soluble | | InChIKey | ICKXRKHJKXMFLR-LPCSYZHESA-N | | SMILES | O.Cl.COc1ccc(CCN(C)CCC[C@](C#N)(C(C)C)c2ccc(OC)c(OC)c2)cc1OC |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | S(-)-VERAPAMIL Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Both isomers inhibit the p-glycoprotein efflux pump in multidrug resistant tumor cells. | | Definition | ChEBI: (S)-verapamil hydrochloride is a hydrochloride salt resulting from the reaction of equimolar amounts of (S)-verapamil and hydrogen chloride. It is an enantiomer of a dexverapamil hydrochloride. | | Biochem/physiol Actions | Active enantiomer of (±)-verapamil. Ca2+ channel (L-type) modulator; adrenoceptor antagonist; cardiac depressant. |
| | S(-)-VERAPAMIL Preparation Products And Raw materials |
|