|
|
| | 4,4'-DI-TERT-BUTYLBENZOPHENONE Basic information |
| Product Name: | 4,4'-DI-TERT-BUTYLBENZOPHENONE | | Synonyms: | 4,4'-DI-T-BUTYLBENZOPHENONE;4,4'-DI-TERT-BUTYLBENZOPHENONE;BIS-(4-TERT-BUTYL-PHENYL)-METHANONE;4,4'-Di-butylbenzophenone;is-(4-tert-butyl-phenyl)-Methanone;Methanone, bis[4-(1,1-dimethylethyl)phenyl]-;4,4'-Di-tert-butylbenzophenone;di(4-tert-butylphenyl)methylone | | CAS: | 15796-82-4 | | MF: | C21H26O | | MW: | 294.43 | | EINECS: | | | Product Categories: | | | Mol File: | 15796-82-4.mol |  |
| | 4,4'-DI-TERT-BUTYLBENZOPHENONE Chemical Properties |
| Melting point | 132.0 to 136.0 °C | | Boiling point | 158°C/1mmHg(lit.) | | density | 0.978±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystaline | | color | White to Orange to Green | | λmax | 266nm(lit.) | | InChI | InChI=1S/C21H26O/c1-20(2,3)17-11-7-15(8-12-17)19(22)16-9-13-18(14-10-16)21(4,5)6/h7-14H,1-6H3 | | InChIKey | YNPFOBWIQVHZMO-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(C(C)(C)C)C=C1)(C1=CC=C(C(C)(C)C)C=C1)=O | | CAS DataBase Reference | 15796-82-4 |
| | 4,4'-DI-TERT-BUTYLBENZOPHENONE Usage And Synthesis |
| | 4,4'-DI-TERT-BUTYLBENZOPHENONE Preparation Products And Raw materials |
|