(17α)-Pregn-4-ene-3,20-dione manufacturers
|
| | (17α)-Pregn-4-ene-3,20-dione Basic information |
| Product Name: | (17α)-Pregn-4-ene-3,20-dione | | Synonyms: | 17-Isoprogesterone;17α-Progesterone;Progesterone EP Impurity M;Progesterone EP Impurity M (17-alpha-Progesterone);Progesterone Impurity 14(Progesterone EP Impurity M);Progesterone Impurity M (17-alpha-Progesterone);Pregn-4-ene-3,20-dione, (17α)-;(8S,9S,10R,13S,14S,17R)-17-acetyl-10,13-dimethyl-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3(2H)-one | | CAS: | 2000-66-0 | | MF: | C21H30O2 | | MW: | 314.46 | | EINECS: | | | Product Categories: | | | Mol File: | 2000-66-0.mol |  |
| | (17α)-Pregn-4-ene-3,20-dione Chemical Properties |
| Melting point | 145 °C | | Boiling point | 447.2±45.0 °C(Predicted) | | density | 1.08±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Dioxane (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1/C21H30O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h12,16-19H,4-11H2,1-3H3/t16-,17-,18-,19-,20-,21+/s3 | | InChIKey | RJKFOVLPORLFTN-LINJWTMNNA-N | | SMILES | C[C@]12CCC(=O)C=C1CC[C@@]1([H])[C@]3([H])CC[C@@H](C(=O)C)[C@@]3(C)CC[C@]21[H] |&1:1,10,12,16,20,24,r| |
| | (17α)-Pregn-4-ene-3,20-dione Usage And Synthesis |
| Uses | 17α-Progesterone is a testosterone precursror generated from cholesterol. Also used as a diagnostic agent in the identification and study of ovarian Leydig cell tumor disease. |
| | (17α)-Pregn-4-ene-3,20-dione Preparation Products And Raw materials |
|