|
|
| | 20α-Acetoxy-4-pregnen-3-one Basic information |
| Product Name: | 20α-Acetoxy-4-pregnen-3-one | | Synonyms: | 20α-Acetoxy-4-pregnen-3-one;Progesterone EP Impurity D;Progesterone Impurity 4(Progesterone EP Impurity D);Progesterone EP IMP D;Progesterone Impurity D;20αF-acetoxy-pregn-4-en-3-one;Progesterone BP Impurity D;(S)-1-((8S,9S,10R,13S,14S,17S)-10,13-Dimethyl-3-oxo-2,3,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethyl acetate (Progesterone Impurity) | | CAS: | 5035-09-6 | | MF: | C23H34O3 | | MW: | 358.51 | | EINECS: | | | Product Categories: | Impurities, Intermediates, Pharmaceuticals, Intermediates & Fine Chemicals, Steroids | | Mol File: | 5035-09-6.mol |  |
| | 20α-Acetoxy-4-pregnen-3-one Chemical Properties |
| Melting point | 138-140 °C | | Boiling point | 461.7±14.0 °C(Predicted) | | density | 1.09±0.1 g/cm3(Predicted) | | InChIKey | PXCKOQHPOYLYPE-LMKQXYAQSA-N | | SMILES | C1(=O)C=C2[C@](C)(CC1)[C@]1([H])[C@]([H])([C@@]3([H])[C@@](CC1)(C)[C@@H]([C@@H](OC(C)=O)C)CC3)CC2 |
| | 20α-Acetoxy-4-pregnen-3-one Usage And Synthesis |
| Uses | 20α-Acetoxy-4-pregnen-3-one is an impurity of Progesterone (P755900), a steroid hormone that is readily secreted by the corpus luteum. 20α-Acetoxy-4-pregnen-3-one is also an intermediate that undergoe
s selective oxidation for the synthesis of testosterone (T155000) and of 4-pregnen-20β-ol-3-one. |
| | 20α-Acetoxy-4-pregnen-3-one Preparation Products And Raw materials |
|