1H,1H-Nonafluoro-3,6-dioxaheptan-1-ol manufacturers
|
| | 1H,1H-Nonafluoro-3,6-dioxaheptan-1-ol Basic information |
| Product Name: | 1H,1H-Nonafluoro-3,6-dioxaheptan-1-ol | | Synonyms: | Ethanol, 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]-;2,2-Difluoro-2-(1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy)ethan-1-ol;2,2-Difluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethanol;1H,1H-Nonafluoro-3,6-dioxaheptan-1-ol | | CAS: | 330562-43-1 | | MF: | C5H3F9O3 | | MW: | 282.06 | | EINECS: | | | Product Categories: | | | Mol File: | 330562-43-1.mol |  |
| | 1H,1H-Nonafluoro-3,6-dioxaheptan-1-ol Chemical Properties |
| Boiling point | 117 | | density | 1.654±0.06 g/cm3(Predicted) | | form | liquid | | pka | 13.11±0.10(Predicted) | | color | Clear | | InChI | InChI=1S/C6H3Br2ClO2S/c7-5-2-1-4(3-6(5)8)12(9,10)11/h1-3H | | InChIKey | MRBIEXKSTURAOV-UHFFFAOYSA-N | | SMILES | FC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)CO | | EPA Substance Registry System | 1H,1H-Nonafluoro-3,6-dioxaheptan-1-ol (330562-43-1) |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2909199090 | | Storage Class | 10 - Combustible liquids |
| | 1H,1H-Nonafluoro-3,6-dioxaheptan-1-ol Usage And Synthesis |
| | 1H,1H-Nonafluoro-3,6-dioxaheptan-1-ol Preparation Products And Raw materials |
|