|
|
| | Ethyl N,N-diethylaminoacetate Basic information |
| Product Name: | Ethyl N,N-diethylaminoacetate | | Synonyms: | ethyl(diethylamino)acetate;ethyln,n-diethylglycinate;n,n-diethyl-glycinethylester;(Diethylamino)acetic acid ethyl ester;N,N-Diethylglycine ethyl ester;2-(diethylamino)acetic acid ethyl ester;ethyl 2-(diethylamino)ethanoate;ethyl 2-(diethylamino)acetateethyl 2-(diethylamino)acetate | | CAS: | 2644-21-5 | | MF: | C8H17NO2 | | MW: | 159.23 | | EINECS: | 220-151-8 | | Product Categories: | | | Mol File: | 2644-21-5.mol |  |
| | Ethyl N,N-diethylaminoacetate Chemical Properties |
| InChI | InChI=1S/C8H17NO2/c1-4-9(5-2)7-8(10)11-6-3/h4-7H2,1-3H3 | | InChIKey | ORRQJZMYQQDYDX-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)CN(CC)CC |
| | Ethyl N,N-diethylaminoacetate Usage And Synthesis |
| | Ethyl N,N-diethylaminoacetate Preparation Products And Raw materials |
|