|
|
| | 3-Amino-2-oxazolidinone d4 Basic information |
| | 3-Amino-2-oxazolidinone d4 Chemical Properties |
| Melting point | 62-64°C | | storage temp. | Refrigerator | | solubility | DMSO (Sparingly), Methanol (Slightly) | | form | Solid | | color | White to Pale Beige | | Major Application | clinical testing | | InChI | InChI=1S/C3H6N2O2/c4-5-1-2-7-3(5)6/h1-2,4H2/i1D2,2D2 | | InChIKey | KYCJNIUHWNJNCT-LNLMKGTHSA-N | | SMILES | C1([2H])([2H])C([2H])([2H])OC(=O)N1N | | CAS DataBase Reference | 1188331-23-8 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 28459000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-Amino-2-oxazolidinone d4 Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | 3-AMINO-2-OXAZOLIDINONE D4, intended for use as an internal standard for the quantification of AOZ by GC- or LC-mass spectrometry. | | Uses | A labelled metabolite of Furazolidone |
| | 3-Amino-2-oxazolidinone d4 Preparation Products And Raw materials |
|