|
|
| | 1,2-Cyclohexanedicarboximide Basic information |
| Product Name: | 1,2-Cyclohexanedicarboximide | | Synonyms: | CIS-HEXAHYDROPHTHALIMIDE;CIS-1 2-CYCLOHEXANEDICARBOXIMIDE;HEXAHYDROPHTHALIMIDE;HEXAHYDROPHTHALIMIDE (HHPI);1,2-Cyclohexanedicarboximide;hexahydrophthalimide,1,2-Cyclohexanedicarboximide;3a,4,5,6,7,7a-Hexahydro-1H-isoindole-1,3(2H)-dione;Hexahydroisoindoline-1,3-dione | | CAS: | 1444-94-6 | | MF: | C8H11NO2 | | MW: | 153.18 | | EINECS: | 215-889-2 | | Product Categories: | Acids and Derivatives;Heterocycles;Diels-Alder Adducts;API intermediates;Heterocyclic Building Blocks;Imidazoles ,Homopiperidines | | Mol File: | 1444-94-6.mol |  |
| | 1,2-Cyclohexanedicarboximide Chemical Properties |
| Melting point | 135.0 to 139.0 °C | | Boiling point | 105 °C(Press: 0.15 Torr) | | density | 1.180±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 11.97±0.20(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C8H11NO2/c10-7-5-3-1-2-4-6(5)8(11)9-7/h5-6H,1-4H2,(H,9,10,11) | | InChIKey | WLDMPODMCFGWAA-UHFFFAOYSA-N | | SMILES | C1(=O)C2C(CCCC2)C(=O)N1 | | CAS DataBase Reference | 1444-94-6(CAS DataBase Reference) | | EPA Substance Registry System | 1H-Isoindole-1,3(2H)-dione, hexahydro- (1444-94-6) |
| TSCA | TSCA listed | | HS Code | 2933998090 |
| | 1,2-Cyclohexanedicarboximide Usage And Synthesis |
| Chemical Properties | white crystalline powder |
| | 1,2-Cyclohexanedicarboximide Preparation Products And Raw materials |
|