|
|
| | N,N-Dimethylformamide sulfur trioxide complex Basic information |
| Product Name: | N,N-Dimethylformamide sulfur trioxide complex | | Synonyms: | SULFUR TRIOXIDE N,N-DIMETHYLFORMAMIDE COMPLEX;n,n-dimethyl-formamidcompd.withsulfurtrioxide(1:1);N,N-dimethylformamide, compound with sulphur trioxide;Sulfur trioxide N,N-diMethylforMaMide coMplex 97%;DMF-sulfur trioxide complex;Sulfur trioxide N, N-dimethylformamide complex, 47+% active SO;Sulphur trioxide N,N-dimethylformamide complex;Sulfur trioxide N,N-dimethylformamide complex,47+% active SO3 | | CAS: | 29584-42-7 | | MF: | C3H7NO4S | | MW: | 153.15 | | EINECS: | 249-701-5 | | Product Categories: | Sulfur-Based;Oxidation;Synthetic Reagents | | Mol File: | 29584-42-7.mol |  |
| | N,N-Dimethylformamide sulfur trioxide complex Chemical Properties |
| Melting point | 155-158 °C(lit.) | | storage temp. | 2-8°C | | solubility | DMSO (Sparingly), Water (Slightly) | | form | Crystals | | color | Beige to slightly brown | | Stability: | Stable. Incompatible with strong oxidizing agents. Sensitive to moisture. | | InChI | InChI=1S/C3H7NO.O3S/c1-4(2)3-5;1-4(2)3/h3H,1-2H3; | | InChIKey | AFDQGRURHDVABZ-UHFFFAOYSA-N | | SMILES | N(C)(C)C=O.S(=O)(=O)=O | | CAS DataBase Reference | 29584-42-7 | | EPA Substance Registry System | Formamide, N,N-dimethyl-, compd. with sulfur trioxide (1:1) (29584-42-7) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | F | 3-10-21 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29211999 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | N,N-Dimethylformamide sulfur trioxide complex Usage And Synthesis |
| Chemical Properties | white crystalline solid | | Uses | Reactant for preparation of:
- Aminopyridines as inhibitors of tetrameric fructose-1,6-bisphosphatase
- Cyclic sulfates
- A dual acid site-grafted zirconium hydroxide-anchored catalyst
| | reaction suitability | reagent type: oxidant |
| | N,N-Dimethylformamide sulfur trioxide complex Preparation Products And Raw materials |
|