| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
3-Oxo-3-(2-trifluoromethylphenyl)propionic acid ethyl ester manufacturers
|
| | 3-Oxo-3-(2-trifluoromethylphenyl)propionic acid ethyl ester Basic information |
| | 3-Oxo-3-(2-trifluoromethylphenyl)propionic acid ethyl ester Chemical Properties |
| Boiling point | 237-238 °C (lit.) | | density | 1.258 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.4875(lit.) | | Fp | >230 °F | | storage temp. | Storage temp. 2-8°C | | pka | 9.55±0.46(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | 1S/C12H11F3O3/c1-2-18-11(17)7-10(16)8-5-3-4-6-9(8)12(13,14)15/h3-6H,2,7H2,1H3 | | InChIKey | KMPAHDWULITWIH-UHFFFAOYSA-N | | SMILES | CCOC(=O)CC(=O)c1ccccc1C(F)(F)F | | CAS DataBase Reference | 89424-17-9(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 2916399090 | | Storage Class | 10 - Combustible liquids |
| | 3-Oxo-3-(2-trifluoromethylphenyl)propionic acid ethyl ester Usage And Synthesis |
| | 3-Oxo-3-(2-trifluoromethylphenyl)propionic acid ethyl ester Preparation Products And Raw materials |
|