| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Coelenterazine hcp Basic information |
| Product Name: | Coelenterazine hcp | | Synonyms: | IMIDAZO[1,2-A]PYRAZIN-3(7H)-ONE, 8-(CYCLOPENTYLMETHYL)-6-(4-HYDROXYPHENYL)-2-(PHENYLMETHYL)-;CLZ-HCP;CLZN-HCP;COELENTERAZINE HCP;COELENTERAZINE-HCP, SYNTHETIC;2-BENZYL-6-(P-HYDROXYPHENYL)-8-CYCLOPENTYLMETHYLIMIDAZO[1,2-A]PYRAZIN-3-(7H)-ONE;CLZN hcp [Coelenterazine hcp];Coelenterazine hcp *CAS 123437-32-1* | | CAS: | 123437-32-1 | | MF: | C25H25N3O2 | | MW: | 399.48 | | EINECS: | | | Product Categories: | Heterocycle;Imidazo[1,2-a]pyrazin-3(7H)-one | | Mol File: | 123437-32-1.mol |  |
| | Coelenterazine hcp Chemical Properties |
| Melting point | >200℃ | | storage temp. | -20°C | | solubility | Soluble in ethanol, methanol | | form | solid | | color | Yellow | | λmax | 433nm | | Biological Applications | Calcium indicator; assaying luminescent enzyme; measuring luciferase activity; as a substrate for luciferase; screening HIV-1 protease inhibitors; bioluminescence resonance energy transfer (BRET) detection system | | InChI | 1S/C25H25N3O2/c29-20-12-10-19(11-13-20)23-16-28-24(21(26-23)14-17-8-4-5-9-17)27-22(25(28)30)15-18-6-2-1-3-7-18/h1-3,6-7,10-13,16-17,26,29H,4-5,8-9,14-15H2 | | InChIKey | YEGCUOQUFAXCMK-UHFFFAOYSA-N | | SMILES | Oc1ccc(cc1)C2=CN3C(=O)C(Cc4ccccc4)=NC3=C(CC5CCCC5)N2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Coelenterazine hcp Usage And Synthesis |
| Uses | Coelenterazine hcp has been used:
- as a component of coelenterazine reagent in the reporter assay
- in the purification of Renilla luciferase-labeled Annexin V
- in evaluating the activity of aequorin in Escherichia coli
| | General Description | Coelenterazine hcp is a semisynthetic analog of coelenterazine. | | Biochem/physiol Actions | Coelenterazine hcp has 190 times higher luminescence intensity than native coelenterazine and a faster response time than native coelenterazine. |
| | Coelenterazine hcp Preparation Products And Raw materials |
|