| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
- Z7-Eicosen-11-one
-
-
2026-08-26
- CAS:63408-44-6
- Min. Order: 1kg
- Purity: >=90%
- Supply Ability: 1
|
| | (13Z)-Eicosen-10-one Basic information |
| | (13Z)-Eicosen-10-one Chemical Properties |
| Boiling point | 172 °C(Press: 1 Torr) | | density | 0.842±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C20H38O/c1-3-5-7-9-11-13-15-17-19-20(21)18-16-14-12-10-8-6-4-2/h13,15H,3-12,14,16-19H2,1-2H3/b15-13- | | InChIKey | HVUBXNQWXJBVHB-SQFISAMPSA-N | | SMILES | CCCCCCCCCC(=O)CC/C=C\CCCCCC |
| | (13Z)-Eicosen-10-one Usage And Synthesis |
| Uses | (13Z)-Eicosen-10-one can be utilized in biological study and agricultural use in method of producing sustained release lure for pest control, by mixing perimones inducible for e.g. aphids and ticks, with organic solvent, supporting pheromone solution to an inorganic carrier and introducing the complex to sunscreen container. | | Definition | ChEBI: 7Z-Eicosen-11-one is a ketone. | | Application | (13Z)-Eicosen-10-one is often used as a pheromone, used in Peach Fruit Moth (Carposina niponensis). |
| | (13Z)-Eicosen-10-one Preparation Products And Raw materials |
|