|
|
| | Cyanuric acid (13C3) Basic information |
| Product Name: | Cyanuric acid (13C3) | | Synonyms: | 1,3,5-Triazine-2,4,6-triol-13C3;1,3,5-Triazine-2,4,6-trione-13C3;2,4,6-Trihydroxy-1,3,5-triazine-13C3;2,4,6-Trihydroxy-s-triazine-13C3;NSC 6284-13C3;Pseudocyanuric Acid-13C3;Tricyanic Acid-13C3;[13C3]-Cyanuric Acid | | CAS: | 201996-37-4 | | MF: | C3H3N3O3 | | MW: | 132.1 | | EINECS: | | | Product Categories: | Aromatics, Heterocycles;Aromatics;Heterocycles | | Mol File: | 201996-37-4.mol |  |
| | Cyanuric acid (13C3) Chemical Properties |
| Melting point | >300°C | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Very Slightly, Heated) | | form | Solid | | color | White to Pale Beige | | Major Application | cleaning products
cosmetics
environmental
food and beverages
personal care | | InChI | 1S/C3H3N3O3/c7-1-4-2(8)6-3(9)5-1/h(H3,4,5,6,7,8,9)/i1+1,2+1,3+1 | | InChIKey | ZFSLODLOARCGLH-VMIGTVKRSA-N | | SMILES | O=[13C]1N[13C](=O)N[13C](=O)N1 | | CAS DataBase Reference | 201996-37-4 |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | 1 | | Storage Class | 11 - Combustible Solids |
| | Cyanuric acid (13C3) Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Cyanuric Acid-13C3 is useful for diagnostic determination of Melamine and related compounds in kidney tissue. |
| | Cyanuric acid (13C3) Preparation Products And Raw materials |
|