|
|
| | 1-Ethoxy-4-(trans-4-pentylcyclohexyl)benzene Basic information |
| Product Name: | 1-Ethoxy-4-(trans-4-pentylcyclohexyl)benzene | | Synonyms: | 1-ETHOXY-4-(TRANS-4-N-PENTYLCYCLOHEXYL)BENZENE;1-ETHOXY-4-(4-PENTYLCYCLOHEXYL)BENZENE;trans-p-(4-pentylcyclohexyl)phenetole;1-Ethoxy-4-(trans-4-pentylcyclohexyl)benzene;trans-4-(4-Pentylcyclohexyl)phenetole;4-(TRANS-4-PENTYLCYCLOHEXYL)-1-ETHOXY-BENZENE;1-Ethoxy-4-(4β-pentylcyclohexan-1α-yl)benzene;Einecs 283-125-5 | | CAS: | 84540-32-9 | | MF: | C19H30O | | MW: | 274.44 | | EINECS: | 283-125-5 | | Product Categories: | Liquid crystal intermediates | | Mol File: | 84540-32-9.mol |  |
| | 1-Ethoxy-4-(trans-4-pentylcyclohexyl)benzene Chemical Properties |
| Melting point | 53 °C | | Boiling point | 375.7±21.0 °C(Predicted) | | density | 0.920±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C19H30O/c1-3-5-6-7-16-8-10-17(11-9-16)18-12-14-19(15-13-18)20-4-2/h12-17H,3-11H2,1-2H3/t16-,17- | | InChIKey | GJHKWLSRHNWTAN-QAQDUYKDSA-N | | SMILES | C1(OCC)=CC=C([C@@H]2CC[C@@H](CCCCC)CC2)C=C1 | | CAS DataBase Reference | 84540-32-9 |
| | 1-Ethoxy-4-(trans-4-pentylcyclohexyl)benzene Usage And Synthesis |
| Uses | Intermediates of Liquid Crystals |
| | 1-Ethoxy-4-(trans-4-pentylcyclohexyl)benzene Preparation Products And Raw materials |
|