Methyl 11-hydroxyundecanoate manufacturers
|
| | Methyl 11-hydroxyundecanoate Basic information |
| | Methyl 11-hydroxyundecanoate Chemical Properties |
| Melting point | 27.5°C | | Boiling point | 296.74°C (rough estimate) | | density | 0.9542 | | refractive index | 1.4410 (estimate) | | InChI | InChI=1S/C12H24O3/c1-15-12(14)10-8-6-4-2-3-5-7-9-11-13/h13H,2-11H2,1H3 | | InChIKey | VASIFKMMXNGAGN-UHFFFAOYSA-N | | SMILES | C(OC)(=O)CCCCCCCCCCO |
| | Methyl 11-hydroxyundecanoate Usage And Synthesis |
| Synthesis Reference(s) | Journal of the American Chemical Society, 100, p. 2268, 1978 DOI: 10.1021/ja00475a068 |
| | Methyl 11-hydroxyundecanoate Preparation Products And Raw materials |
|