- Progesterone Impurity
-
- $0.00 / 100mg
-
2025-12-16
- CAS:24254-01-1
- Min. Order: 10mg
- Purity: 95
- Supply Ability: 100000
|
| | 3-Oxopregn-4-ene-20-carbaldehyde Basic information |
| Product Name: | 3-Oxopregn-4-ene-20-carbaldehyde | | Synonyms: | 3-Oxopregn-4-ene-20-carbaldehyde;20-Formylpregn-4-en-3-one;Pregn-4-ene-20-carboxaldehyde, 3-oxo-;20-hydroxypregn-4-ene-3-one (BA);Progesterone EP Impurity I (Mixture of Diastereomers);2-((8S,9S,10R,13S,14S,17R)-10,13-dimethyl-3-oxo-2,3,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)propanal;20-formylpregn-4-en-3-onee;Progesterone Impurity I | | CAS: | 24254-01-1 | | MF: | C22H32O2 | | MW: | 328.49 | | EINECS: | | | Product Categories: | 24254-01-1 | | Mol File: | 24254-01-1.mol |  |
| | 3-Oxopregn-4-ene-20-carbaldehyde Chemical Properties |
| Melting point | 156-160 °C | | Boiling point | 459.4±14.0 °C(Predicted) | | density | 1.07±0.1 g/cm3(Predicted) | | InChI | InChI=1S/C22H32O2/c1-14(13-23)18-6-7-19-17-5-4-15-12-16(24)8-10-21(15,2)20(17)9-11-22(18,19)3/h12-14,17-20H,4-11H2,1-3H3/t14,17-,18+,19-,20-,21-,22+/m0/s1 | | InChIKey | XVPJEGGIGJLDQK-ZRFCQXGJSA-N | | SMILES | C1(=O)C=C2[C@](C)(CC1)[C@]1([H])[C@]([H])([C@@]3([H])[C@@](CC1)(C)[C@@H](C(C=O)C)CC3)CC2 | | EPA Substance Registry System | 20-Formylpregn-4-en-3-one (24254-01-1) |
| | 3-Oxopregn-4-ene-20-carbaldehyde Usage And Synthesis |
| Uses | 3-Oxopregn-4-ene-20-carboxaldehyde is used in magnetic based graphene composites with steroidal diamine dimer as potential drug in hyperthermia cancer therapy. |
| | 3-Oxopregn-4-ene-20-carbaldehyde Preparation Products And Raw materials |
|