| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-[(Boc-amino)methyl]benzoic acid Basic information |
| Product Name: | 2-[(Boc-amino)methyl]benzoic acid | | Synonyms: | Boc-OaMb;2-(Boc-aminomethyl)benzoic acid 98%;2-(Boc-aminomethyl)benzoic acid≥ 97% (HPLC);2-((Tert-Butoxy)Carbonyl aminomethyl)benzoic acid 98%;2-({[(tert-butoxy)carbonyl]amino}methyl)benzoic acid;Benzoic acid, 2-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]-;2-[1-amino-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]benzoic acid;Boc-Oamb-OH | | CAS: | 669713-61-5 | | MF: | C13H17NO4 | | MW: | 251.28 | | EINECS: | | | Product Categories: | | | Mol File: | 669713-61-5.mol | ![2-[(Boc-amino)methyl]benzoic acid Structure](CAS/GIF/669713-61-5.gif) |
| | 2-[(Boc-amino)methyl]benzoic acid Chemical Properties |
| storage temp. | Store at Room Tem. | | form | powder | | Major Application | peptide synthesis | | InChI | 1S/C13H17NO4/c1-13(2,3)18-12(17)14-8-9-6-4-5-7-10(9)11(15)16/h4-7H,8H2,1-3H3,(H,14,17)(H,15,16) | | InChIKey | FAZMFLNCRFKVDW-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)NCc1ccccc1C(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 29225090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-[(Boc-amino)methyl]benzoic acid Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | 2-[[(tert-Butoxycarbonyl)amino]methyl]benzoic Acid is a reagent used in the synthesis of amixicile scaffolds I inhibitor against Clostridium difficile. |
| | 2-[(Boc-amino)methyl]benzoic acid Preparation Products And Raw materials |
|