| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Bis(pentamethylcyclopentadienyl)chromium Basic information |
| Product Name: | Bis(pentamethylcyclopentadienyl)chromium | | Synonyms: | DECAMETHYLCHROMOCENE;BIS(PENTAMETHYLCYCLOPENTADIENYL)CHROMIUM(II);Bis(pentamethylcyclopentadienyl)chrom;Bis(pentamethylcyclopentadienyl)chromium,min.95%(Decamethylchromocene);Bis(pentamethylcyclopentadienyl)chromium, 98+% (Decamethylchromocene);BIS(PENTAMETHYLCYCLOPENTADIENYL)CHROMIUM , (DECAMETHYLCHROMOCENE);Bis(pentamethylcyclopentadienyl)chromium, 95+%;Bis(pentamethylcyclopentadienyl)chromium,95%(Decamethylchromocene) | | CAS: | 74507-61-2 | | MF: | C20H30Cr | | MW: | 322.45 | | EINECS: | | | Product Categories: | | | Mol File: | 74507-61-2.mol |  |
| | Bis(pentamethylcyclopentadienyl)chromium Chemical Properties |
| storage temp. | -20°C | | form | Powder | | color | brown | | Sensitive | Air & Moisture Sensitive | | InChI | 1S/2C10H15.Cr/c2*1-6-7(2)9(4)10(5)8(6)3;/h2*1-5H3; | | InChIKey | GEYKKJXGTKHSDI-UHFFFAOYSA-N | | SMILES | [Cr].C[C]1[C](C)[C](C)[C](C)[C]1C.C[C]2[C](C)[C](C)[C](C)[C]2C | | CAS DataBase Reference | 74507-61-2 | | NIST Chemistry Reference | Chromocene, decamethyl-(74507-61-2) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 36-37/39-26 | | RIDADR | UN3181 | | WGK Germany | 3 | | HazardClass | 4.1 | | PackingGroup | III | | HS Code | 29310099 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
| | Bis(pentamethylcyclopentadienyl)chromium Usage And Synthesis |
| Chemical Properties | black crystalline powder | | reaction suitability | core: chromium |
| | Bis(pentamethylcyclopentadienyl)chromium Preparation Products And Raw materials |
|