| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Amino-5-bromo-4-trifluoromethylpyridine Basic information | | Uses |
| Product Name: | 2-Amino-5-bromo-4-trifluoromethylpyridine | | Synonyms: | 5-bromo-4-(trifluoromethyl)-2-pyridylamine;2-Pyridinamine, 5-bromo-4-(trifluoromethyl)-;5-Bromo-4-(trifluoromethyl)-2-pyridinamine;2-Amino-5-bromo-4-(trifL;2-Amino-5-bromo-4-(trifluoromethyl)pyridine,95%;5-Bromo-2-amino-4-trifluoromethylpyridine;2-Amino-5-bromo-4-(trifluoromethyl)pyridine（RM for Indian lab);5-BroMo-4-trifluoroMethyl-pyridin-2-ylaMine | | CAS: | 944401-56-3 | | MF: | C6H4BrF3N2 | | MW: | 241.01 | | EINECS: | 693-695-0 | | Product Categories: | | | Mol File: | 944401-56-3.mol |  |
| | 2-Amino-5-bromo-4-trifluoromethylpyridine Chemical Properties |
| Melting point | 71-74℃ | | Boiling point | 243.9±40.0 °C(Predicted) | | density | 1.790±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | soluble in Methanol | | form | Solid | | pka | 2.44±0.24(Predicted) | | color | Pale yellow to orange | | InChI | InChI=1S/C6H4BrF3N2/c7-4-2-12-5(11)1-3(4)6(8,9)10/h1-2H,(H2,11,12) | | InChIKey | AEWYLVDLWQPJGW-UHFFFAOYSA-N | | SMILES | C1(N)=NC=C(Br)C(C(F)(F)F)=C1 | | CAS DataBase Reference | 944401-56-3 |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38-36-22 | | Safety Statements | 22-24/25-26-36/37/39 | | WGK Germany | 1 | | HazardClass | IRRITANT | | HS Code | 29333999 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2 |
| | 2-Amino-5-bromo-4-trifluoromethylpyridine Usage And Synthesis |
| Uses | 5-Bromo-4-(trifluoromethyl)pyridine-2-amine can be used as a pharmaceutical synthesis intermediate. | | Synthesis | Step 1: Synthesis of 5-bromo-4-(trifluoromethyl)pyridin-2-amine
To a stirred solution of 4-(trifluoromethyl)pyridin-2-amine (2.5 g, 15.42 mmol) in dichloromethane (250 mL) was added N-bromosuccinimide (2.74 g, 15.42 mmol) in batches. The reaction was carried out at room temperature and under light protection with continuous stirring for 6 hours. After completion of the reaction, the reaction mixture was diluted with 1N NaOH solution (20 mL) and extracted with dichloromethane (2 x 100 mL). The organic layers were combined, dried with anhydrous sodium sulfate, filtered and concentrated under reduced pressure to give the title compound (3.2 g, 86% yield).
1H NMR (400 MHz, CDCl3): δ 8.28 (s, 1H), 6.77 (s, 1H), 4.73 (brs, 2H).
ESI-MS: Calculated: 239.95; Measured: 239.10 [M-H] | | References | [1] Patent: WO2017/219800, 2017, A1. Location in patent: Paragraph 00209; 00210
[2] Patent: CN105461714, 2016, A. Location in patent: Paragraph 0367; 0368; 0369
[3] Patent: CN103483345, 2016, B. Location in patent: Paragraph 0131-0134
[4] Patent: CN103694218, 2016, B. Location in patent: Paragraph 0093-0096
[5] Patent: WO2014/169167, 2014, A1. Location in patent: Page/Page column 56 |
| | 2-Amino-5-bromo-4-trifluoromethylpyridine Preparation Products And Raw materials |
|