|
|
| | Dichloro[9,9-dimethyl-4,5-bis(diphenylphosphino)xanthene]palladium(II), min. 98% Basic information |
| Product Name: | Dichloro[9,9-dimethyl-4,5-bis(diphenylphosphino)xanthene]palladium(II), min. 98% | | Synonyms: | Dichloro[9,9-diMethyl-4,5-bis(diphenylphosphino)xanthene]palladiuM(II),Min.98%;Dichloro[9,9-diMethyl-4,5-bis(diphenylphosphino)xanthene]palladiuM(II),98%;Dichloro[9,9-dimethyl-4,5-bis(diphenylphosphino)xanthene]palladium(II), min. 98%;Dichloro[9,9-diMethyl-4,5-bis(diphenylphosphino)xanthene]palladiuM(II);Dichloro[9,9-diMethyl-4,5-bis(;bis(diphenylphosphino)xanthene]palladiuM(II);dichloropalladium,(5-diphenylphosphanyl-9,9-dimethylxanthen-4-yl)-diphenylphosphane;Dichloro[9,9-diMethyl-4,5-bis(diphenylphosphino)xanthene | | CAS: | 205319-10-4 | | MF: | C39H34Cl2OP2Pd | | MW: | 757.97 | | EINECS: | | | Product Categories: | Pd;organometallic complex | | Mol File: | 205319-10-4.mol | ![Dichloro[9,9-dimethyl-4,5-bis(diphenylphosphino)xanthene]palladium(II), min. 98% Structure](CAS/20150408/GIF/205319-10-4.gif) |
| | Dichloro[9,9-dimethyl-4,5-bis(diphenylphosphino)xanthene]palladium(II), min. 98% Chemical Properties |
| Melting point | 280-287℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Crystalline solid | | color | Yellow | | InChIKey | HEYONDYPXIUDCK-UHFFFAOYSA-L | | SMILES | [Cl-][Pd+2]1(P(C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=C3C(C)(C)C4=CC=CC(=C4OC=23)P1(C1C=CC=CC=1)C1C=CC=CC=1)[Cl-] | | CAS DataBase Reference | 205319-10-4 |
| Risk Statements | 43 | | Safety Statements | 24-37-60 | | WGK Germany | 3 | | TSCA | No | | HS Code | 2932.99.7000 |
| | Dichloro[9,9-dimethyl-4,5-bis(diphenylphosphino)xanthene]palladium(II), min. 98% Usage And Synthesis |
| Uses | Effective catalyst for carbonylation of aryl halides | | reaction suitability | core: palladium reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Cross Couplings reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: catalyst |
| | Dichloro[9,9-dimethyl-4,5-bis(diphenylphosphino)xanthene]palladium(II), min. 98% Preparation Products And Raw materials |
|