|
|
| | DIchloro[bis(diphenylphosphinophenyl)ether]palladium(II) Basic information | | Reaction |
| Product Name: | DIchloro[bis(diphenylphosphinophenyl)ether]palladium(II) | | Synonyms: | Dichloro[bis(diphenylphosphinophenyl)ether]palladium(II);bis(diphenylphosphinophenyl)etherpalladium(II)...;Bis(diphenylphosphinophenyl)ether palladium (II) dichloride;Dichloro[bis(diphenylphosphinophenyl)ether]palladium(II), Pd 14.8%;cis-[Bis[2-(diphenylphosphino)phenyl] ether]dichloropalladium;DICHLORO{BIS[2-(DIPHENYLPHOSPHINO)PHENYL]ETHER}PALLADIUM(II),98%;bis(diphenylphos;)ether]paL | | CAS: | 205319-06-8 | | MF: | C36H28Cl2OP2Pd | | MW: | 717.9 | | EINECS: | | | Product Categories: | | | Mol File: | 205319-06-8.mol | ![DIchloro[bis(diphenylphosphinophenyl)ether]palladium(II) Structure](CAS/GIF/205319-06-8.gif) |
| | DIchloro[bis(diphenylphosphinophenyl)ether]palladium(II) Chemical Properties |
| Melting point | 243-250°C | | storage temp. | 2-8°C | | form | Powder | | color | yellow | | Water Solubility | Insoluble in water. | | InChIKey | VYOUBMJFTDMKRR-UHFFFAOYSA-L | | SMILES | P(C1C=CC=CC=1)(C1=CC=CC=C1)C1=CC=CC=C1OC1C=CC=CC=1P(C1C=CC=CC=1)C1C=CC=CC=1.[Pd](Cl)Cl |
| Risk Statements | 36/37/38 | | Safety Statements | 26-37 | | WGK Germany | 3 | | TSCA | No | | HS Code | 2843909000 | | Storage Class | 11 - Combustible Solids |
| | DIchloro[bis(diphenylphosphinophenyl)ether]palladium(II) Usage And Synthesis |
| Reaction |
- Stereoretentive palladium-catalyzed Kumada-Corriu couplings of alkenyl halides at room temperature.
- Highly selective reactions of unbiased alkenyl halides: Negishi-Plus couplings.
| | Chemical Properties | light yellow powder | | Uses | Dichloro[bis(diphenylphosphinophenyl)ether]palladium(II) is used as a catalyst for cross-coupling reaction of 2-brom-1,3-dienes to prepare high stereoselectivity of conjugated Z,E dienes. |
| | DIchloro[bis(diphenylphosphinophenyl)ether]palladium(II) Preparation Products And Raw materials |
|