| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 4-Cyano-2-methoxyphenylboronic acid Basic information |
| Product Name: | 4-Cyano-2-methoxyphenylboronic acid | | Synonyms: | 4-Cyano-2-methoxyphenylboronic acid;Boronic acid, B-(4-cyano-2-methoxyphenyl)-;4-Cyano-2-Methoxybenzeneboronic acid, 96%;4-Cyano-2-methoxybenzeneboronicacid,96%;B-(4-Cyano-2-methoxyphenyl)boronic acid | | CAS: | 1256345-67-1 | | MF: | C8H8BNO3 | | MW: | 176.96 | | EINECS: | | | Product Categories: | | | Mol File: | 1256345-67-1.mol |  |
| | 4-Cyano-2-methoxyphenylboronic acid Chemical Properties |
| storage temp. | Inert atmosphere,2-8°C | | form | Solid | | Appearance | White to off-white Solid | | InChI | InChI=1S/C8H8BNO3/c1-13-8-4-6(5-10)2-3-7(8)9(11)12/h2-4,11-12H,1H3 | | InChIKey | CCUBWDNQHCIXNF-UHFFFAOYSA-N | | SMILES | B(C1=CC=C(C#N)C=C1OC)(O)O | | CAS DataBase Reference | 1256345-67-1 |
| | 4-Cyano-2-methoxyphenylboronic acid Usage And Synthesis |
| | 4-Cyano-2-methoxyphenylboronic acid Preparation Products And Raw materials |
|