| Company Name: |
Xi'an Kaixin Biotechnology Co., Ltd
|
| Tel: |
029-68881181 13619217766 |
| Email: |
3495811982@qq.com |
| Products Intro: |
Product Name:ATTO390-NHS
Purity:95%+ Package:10mg;25mg;50mg
|
| Company Name: |
Nantong QuanYi Biotechnology Co., Ltd
|
| Tel: |
0513-66337626 18051384581 |
| Email: |
sales@chemhifuture.com |
| Products Intro: |
Product Name:ATTO 390 NHS Ester
Purity:98%+ HPLC Package:10mg，500mg，1g，5g,10g,more
|
|
| | ATTO 390 NHS ESTER Basic information |
| | ATTO 390 NHS ESTER Chemical Properties |
| storage temp. | 2-8°C | | form | powder | | ex/em | 390/472 nm (PBS) | | ε(extinction coefficient) | 24000 L⋅mol−1⋅cm−1 | | Φ(quantum yield) | 0.9 | | InChI | 1S/C24H28N2O6/c1-14-10-23(30)31-19-12-18-16(11-17(14)19)15(2)13-24(3,4)25(18)9-5-6-22(29)32-26-20(27)7-8-21(26)28/h10-12,15H,5-9,13H2,1-4H3 | | InChIKey | ABNZEGUYPHJPQI-UHFFFAOYSA-N | | SMILES | CC1CC(C)(C)N(CCCC(=O)ON2C(=O)CCC2=O)c3cc4OC(=O)C=C(C)c4cc13 |
| WGK Germany | 3 | | F | 8-10 | | Storage Class | 11 - Combustible Solids |
| | ATTO 390 NHS ESTER Usage And Synthesis |
| | ATTO 390 NHS ESTER Preparation Products And Raw materials |
|