|
|
| | AMCA-NHS Basic information |
| Product Name: | AMCA-NHS | | Synonyms: | AMCA-H NHS;7-(Dimethylamino)coumarin-4-acetic acid-NHS;SUCCINIMIDYL-7-AMINO-4-METHYLCOUMARIN-3-ACETATE;N-SUCCINIMIDYL 7-AMINO-4-METHYL-3-COUMARINYLACETATE;AMCA-NHS;AMCA-OSU;7-AMINO-4-METHYL-3-COUMARINACETIC ACID N-SUCCINIMIDYL ESTER;7-AMINO-4-METHYL-3-COUMARINYLACETYL | | CAS: | 113721-87-2 | | MF: | C16H14N2O6 | | MW: | 330.29 | | EINECS: | | | Product Categories: | proteinmod | | Mol File: | 113721-87-2.mol |  |
| | AMCA-NHS Chemical Properties |
| Boiling point | 559.4±60.0 °C(Predicted) | | density | 1.50±0.1 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | DMF: soluble | | form | A solid | | pka | 1.69±0.20(Predicted) | | Appearance | Light yellow solid | | ε(extinction coefficient) | 19000 L⋅mol−1⋅cm−1 | | ex/em | 353/455 nm | | BRN | 9007679 | | InChI | InChI=1S/C16H14N2O6/c1-8-10-3-2-9(17)6-12(10)23-16(22)11(8)7-15(21)24-18-13(19)4-5-14(18)20/h2-3,6H,4-5,7,17H2,1H3 | | InChIKey | ILKQVTIMOGNSAS-UHFFFAOYSA-N | | SMILES | C1(=O)OC2=CC(N)=CC=C2C(C)=C1CC(ON1C(=O)CCC1=O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 8-10-21 | | HS Code | 3212900000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | AMCA-NHS Usage And Synthesis |
| Description | Activated NHS-ester of AMCA (aminomethyl coumarin acetate) dye. This NHS ester is an amine-reactive dye for labeling of amine groups in proteins, peptides, amino-modified oligos, and other target molecules.
AMCA is one of the brightest blue fluorescent dyes. This fluorophore has a relatively large Stoke’s shift, high resistance to photobleaching, and pH-independent fluorescence from pH 4 to 10. AMCA is a widely used fluorophore for multiple-color labeling due to its minimal fluorescence overlap with green- and longer wavelength-emitting fluorescent dyes. | | Chemical Properties | Appearance: Pale yellow solid
ex/em: 353/455 nm
Extinction coefficient (ε): 19000 Lmol1cm1 | | Uses | AMCA-H NHS ester reacts with primary amines at pH 7.0-9.0. Suitable for labeling lysyl residues in proteins. | | Abs/Em Maxima | 348/435 nm | | Fluoresene quantum yield | 0.91 | | Extinction Coefficient | 17400 | | CF260 | 0.16 | | CF280 | 0.13 |
| | AMCA-NHS Preparation Products And Raw materials |
|