| Company Name: |
QUALITY CONTROL SOLUTIONS LTD.
|
| Tel: |
+86-0755-66853366 +8613670046396 |
| Email: |
export03@qcsrm.com |
| Products Intro: |
Product Name:Dospa
Purity:95% HPLC Package:10MG;25MG;50MG;100MG
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:DOSPA
|
|
| Product Name: | DOSPA | | Synonyms: | DOSPA;N-(2-(2,5-Bis((3-aminopropyl)amino)pentanamido)ethyl)-N,N-dimethyl-2,3-bis(oleoyloxy)propan-1-aminium 2,2,2-trifluoroacetate;TIANFU-CHEM DOSPA | | CAS: | 168479-03-6 | | MF: | C56H107F3N6O7 | | MW: | 1033.5 | | EINECS: | | | Product Categories: | | | Mol File: | 168479-03-6.mol |  |
| | DOSPA Chemical Properties |
| storage temp. | -20°C | | form | powder | | Major Application | advanced drug delivery | | SMILES | O=C(C([NH2+]CCC[NH3+])CCC[NH+]([H])CCC[NH3+])NCC[N+](C)(C)CC(OC(CCCCCCC/C=C\CCCCCCCC)=O)COC(CCCCCCC/C=C\CCCCCCCC)=O.[5Cl-] |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | DOSPA Usage And Synthesis |
| Uses | advanced drug delivery |
| | DOSPA Preparation Products And Raw materials |
|