| Company Name: |
Adamas Reagent, Ltd.
|
| Tel: |
400-6009262 15618770481 |
| Email: |
yhx@titansci.com |
| Products Intro: |
Product Name:Benidipine Impurity 6
CAS:76509-17-6
Purity:对照品 Package:10mg~500mg Remarks:AC000955011
|
3-benzyloxypyridine manufacturers
- 3-benzyloxypyridine
-
- $1.00 / 1KG
-
2019-12-25
- CAS:76509-17-6
- Min. Order: 1KG
- Purity: 98%HPLC
- Supply Ability: 10t
|
| | 3-benzyloxypyridine Basic information |
| Product Name: | 3-benzyloxypyridine | | Synonyms: | 3-benzyloxypyridine;3-(PhenylMethoxy)pyridine;Pyridine, 3-(phenylmethoxy)-;Atrazine Impurity 14;Benidipine hydrochloride SM2-4 | | CAS: | 76509-17-6 | | MF: | C12H11NO | | MW: | 185.22 | | EINECS: | | | Product Categories: | | | Mol File: | 76509-17-6.mol |  |
| | 3-benzyloxypyridine Chemical Properties |
| Melting point | 51 °C | | Boiling point | 114 °C(Press: 0.6 Torr) | | density | 1.106±0.06 g/cm3(Predicted) | | form | solid | | pka | 4.74±0.10(Predicted) | | InChI | 1S/C12H11NO/c1-2-5-11(6-3-1)10-14-12-7-4-8-13-9-12/h1-9H,10H2 | | InChIKey | LLWFWIZOFFLRKC-UHFFFAOYSA-N | | SMILES | C1(OCC2=CC=CC=C2)=CC=CN=C1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-benzyloxypyridine Usage And Synthesis |
| Synthesis Reference(s) | The Journal of Organic Chemistry, 62, p. 503, 1997 DOI: 10.1021/jo961957g |
| | 3-benzyloxypyridine Preparation Products And Raw materials |
|