|
|
| | 3S,5R isoMer, or (3S,5R)-7-[3-(phenylcarbaMoyl)-5-(4-fluorophenyl)-2-isopropyl-4-phenyl-1H-pyrrol-1-yl]-3,5-dihydroxyheptanoic acid calciuM salt Basic information |
| Product Name: | 3S,5R isoMer, or (3S,5R)-7-[3-(phenylcarbaMoyl)-5-(4-fluorophenyl)-2-isopropyl-4-phenyl-1H-pyrrol-1-yl]-3,5-dihydroxyheptanoic acid calciuM salt | | Synonyms: | 3S,5R isoMer, or (3S,5R)-7-[3-(phenylcarbaMoyl)-5-(4-fluorophenyl)-2-isopropyl-4-phenyl-1H-pyrrol-1-yl]-3,5-dihydroxyheptanoic acid calciuM salt;Atorvastatin Related Compound B (20 mg) (3S,5R isomer, or (3S,5R)-7-[3-(phenylcarbamoyl)-5-(4-fluorophenyl)-2-isopropyl-4-phenyl-1H-pyrrol-1-yl]-3,5-dihydroxyheptanoic acid calcium salt);3-epi-Atorvastatin;calciuM (3S,5R)-7-(2-(4-fluorophenyl)-5-isopropyl-3-phenyl-4-(phenylcarbaMoyl)-1H-pyrrol-1-yl)-3,5-dihydroxyheptanoate;Atorvastatin IMpurity-A(EP);Atorvastatin IMpurity-B(EP);(3S,5R)-Atorvastatin Calcium Salt;(betaS,deltaR)-2-(4-Fluorophenyl)-beta,delta-dihydroxy-5-(1-methylethyl)-3-phenyl-4-[(phenylamino)carbonyl]-1H-pyrrole-1-heptanoic acid calcium salt (2:1) | | CAS: | 887196-25-0 | | MF: | C33H34CaFN2O5+ | | MW: | 597.7098632 | | EINECS: | | | Product Categories: | | | Mol File: | 887196-25-0.mol | ![3S,5R isoMer, or (3S,5R)-7-[3-(phenylcarbaMoyl)-5-(4-fluorophenyl)-2-isopropyl-4-phenyl-1H-pyrrol-1-yl]-3,5-dihydroxyheptanoic acid calciuM salt Structure](CAS/GIF/887196-25-0.gif) |
| | 3S,5R isoMer, or (3S,5R)-7-[3-(phenylcarbaMoyl)-5-(4-fluorophenyl)-2-isopropyl-4-phenyl-1H-pyrrol-1-yl]-3,5-dihydroxyheptanoic acid calciuM salt Chemical Properties |
| Melting point | 160℃ (decomposition) | | storage temp. | Refrigerator, Under Inert Atmosphere | | solubility | Chloroform (Slightly), DMSO (Slightly, Heated, Sonicated), Methanol (Slightly) | | form | powder | | color | White to Pale Beige | | Major Application | pharmaceutical (small molecule) | | InChIKey | DYJKAHNDTTZSNX-OUPRKWGVSA-M | | SMILES | c1(-c2ccccc2)c(C(=O)Nc2ccccc2)c(C(C)C)[n](CC[C@@H](O)C[C@H](O)CC([O-])=O)c1-c1ccc(F)cc1.[Ca+2] |&1:24,27,r| |
| WGK Germany | WGK 3 | | HS Code | 2933997500 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Repr. 2 |
| | 3S,5R isoMer, or (3S,5R)-7-[3-(phenylcarbaMoyl)-5-(4-fluorophenyl)-2-isopropyl-4-phenyl-1H-pyrrol-1-yl]-3,5-dihydroxyheptanoic acid calciuM salt Usage And Synthesis |
| Uses | (3S,5R)-Atorvastatin Calcium Salt is an isomeric impurity of Atorvastatin Calcium Salt (A791750), a selective, competitive HMG-CoA reductase inhibitor. Atorvastatin is the only drug in its class specf
ically indicated for lowering both elevated LDL-cholesterol and triglycerides in patients with hypercholesterolemia. |
| | 3S,5R isoMer, or (3S,5R)-7-[3-(phenylcarbaMoyl)-5-(4-fluorophenyl)-2-isopropyl-4-phenyl-1H-pyrrol-1-yl]-3,5-dihydroxyheptanoic acid calciuM salt Preparation Products And Raw materials |
|