|
|
| | 3-Dechloro-3-broMo Trazodone Hydrochloride Basic information |
| | 3-Dechloro-3-broMo Trazodone Hydrochloride Chemical Properties |
| Melting point | 211-213℃ (methanol ) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | Off-White to Yellow | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C19H22BrN5O.ClH/c20-16-5-3-6-17(15-16)23-13-11-22(12-14-23)8-4-10-25-19(26)24-9-2-1-7-18(24)21-25;/h1-3,5-7,9,15H,4,8,10-14H2;1H | | InChIKey | XGKUASHFDRCBOF-UHFFFAOYSA-N | | SMILES | Brc1cc(ccc1)N2CCN(CC2)CCC[n]3nc4[n]([c]3=O)cccc4.Cl |
| WGK Germany | WGK 3 | | HS Code | 2933599550 | | Storage Class | 11 - Combustible Solids |
| | 3-Dechloro-3-broMo Trazodone Hydrochloride Usage And Synthesis |
| Chemical Properties | Pale Yellow Solid | | Uses | A trazodone (T718500) impurity. An antipsychotic with potential use as a schizophrenia agent. Trazodone impurity D. Trazodone USP Related Compound D. | | Uses | 3-Dechloro-3-broMo Trazodone Hydrochloride is a trazodone (T718500) impurity, an antipsychotic with potential use as a schizophrenia agent. |
| | 3-Dechloro-3-broMo Trazodone Hydrochloride Preparation Products And Raw materials |
|