|
|
| | 5-AMino-2-Methyl-piperidine-1-carboxylic acid benzyl ester Basic information |
| Product Name: | 5-AMino-2-Methyl-piperidine-1-carboxylic acid benzyl ester | | Synonyms: | (+)-(2S,5R)-benzyl 5-amino-2-methylpiperidine-1-carboxylate;5-AMino-2-Methyl-piperidine-1-carboxylic acid benzyl ester;(2S,5R)-5-Amino-2-methyl-piperidine-1-carboxylic acid benzyl ester;Benzyl 5-amino-2-methyl-1-piperidinecarboxylate;5-AMINO-1-CBZ-2-METHYLPIPERIDINE HCL;Ritlecitinib Impurity 6;(2S,5R)-5-Amino-1-Cbz-2-methylpiperidine;5-AMino-2-Methyl-piperidine-1-carboxylic acid benzyl ester,ritlecitinib | | CAS: | 1207947-49-6 | | MF: | C14H20N2O2 | | MW: | 248.32 | | EINECS: | | | Product Categories: | | | Mol File: | 1207947-49-6.mol |  |
| | 5-AMino-2-Methyl-piperidine-1-carboxylic acid benzyl ester Chemical Properties |
| Boiling point | 373.2±42.0 °C(Predicted) | | density | 1.111±0.06 g/cm3(Predicted) | | storage temp. | Store at 0-8 °C | | pka | 10.34±0.40(Predicted) | | Appearance | yellow oil | | InChI | InChI=1S/C14H20N2O2/c1-11-7-8-13(15)9-16(11)14(17)18-10-12-5-3-2-4-6-12/h2-6,11,13H,7-10,15H2,1H3/t11-,13+/m0/s1 | | InChIKey | MWKAMUJIXBCKIH-WCQYABFASA-N | | SMILES | N1(C(OCC2=CC=CC=C2)=O)C[C@H](N)CC[C@@H]1C |
| | 5-AMino-2-Methyl-piperidine-1-carboxylic acid benzyl ester Usage And Synthesis |
| | 5-AMino-2-Methyl-piperidine-1-carboxylic acid benzyl ester Preparation Products And Raw materials |
|