|
|
| | benzyl(2S,5R)-5-amino-2-methylpiperidine-1-carboxylate Basic information |
| Product Name: | benzyl(2S,5R)-5-amino-2-methylpiperidine-1-carboxylate | | Synonyms: | benzyl(2S,5R)-5-amino-2-methylpiperidine-1-carboxylatehydrochloride;EOS-61887;EOS-62319;(2S,5R)-5-amino-2-methylpiperidine-1-carboxylic acid benzyl ester hydrochloride;(2S,5R)-5-amino-2-methylpiperidine-1-carboxylate;(2S,5R)-Benzyl 5-amino-2-methylpiperidine-1-carboxylate hydrochlorid;benzyl (2S,5R)-5-amino-2-methylpiperidine-1-carboxylate hydrochloride (2S,5R)-5;(2S,5R)-5-amino-2-Methylpiperidine-1-Benzyl formate hydrochloride | | CAS: | 1207853-23-3 | | MF: | C14H21ClN2O2 | | MW: | 284.78 | | EINECS: | 210-077-2 | | Product Categories: | pharmaceutical | | Mol File: | 1207853-23-3.mol |  |
| | benzyl(2S,5R)-5-amino-2-methylpiperidine-1-carboxylate Chemical Properties |
| storage temp. | Sealed in dry,Room Temperature | | Appearance | White to off-white Solid | | InChI | InChI=1/C14H20N2O2.ClH/c1-11-7-8-13(15)9-16(11)14(17)18-10-12-5-3-2-4-6-12;/h2-6,11,13H,7-10,15H2,1H3;1H/t11-,13+;/s3 | | InChIKey | QDXRLZBFPKVDHC-VCSCPQGNNA-N | | SMILES | C(N1C[C@H](N)CC[C@@H]1C)(=O)OCC1C=CC=CC=1.Cl |&1:3,7,r| |
| | benzyl(2S,5R)-5-amino-2-methylpiperidine-1-carboxylate Usage And Synthesis |
| Synthesis | Preparation of compound 30d: Benzyl (2S,5R)-5-amino-2-methylpiperidine-1-carboxylic acid benzyl ester hydrochloride 30c (20 g, 0.057 mol) was dissolved in HCl(g)/Et2O (4N, 100 mL) and the reaction was stirred for 2 hours at room temperature. After completion of the reaction, the mixture was filtered to afford (2S,5R)-5-amino-2-methylpiperidine-1-carboxylic acid benzyl ester 30d hydrochloride as a white solid (16 g, 73% yield). The product was characterized by 1H NMR (400 MHz, DMSO): δppm 1.097-1.080 (d, 3H), 1.627-1.573 (m, 2H), 1.849-1.749 (m, 2H), 2.991-2.978 (m, 2H), 4.158-4.139 (d, 1H), 4.317-4.292 ( m, 1H), 5.072 (s, 2H), 7.386-7.305 (m, 5H), 8.392 (s, 3H). | | References | [1] Patent: WO2010/16005, 2010, A1. Location in patent: Page/Page column 135-137 |
| | benzyl(2S,5R)-5-amino-2-methylpiperidine-1-carboxylate Preparation Products And Raw materials |
|