| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | tert-Butyl N-[2-hydroxy-1,1-bis(hydroxymethyl)-ethyl]carbamate Basic information |
| Product Name: | tert-Butyl N-[2-hydroxy-1,1-bis(hydroxymethyl)-ethyl]carbamate | | Synonyms: | [2-hydroxy-1,1-bis(hydroxymethyl)ethyl]-1,1-dimethylethyl Carbamic acid ester;tert-Butyl N-[2-hydroxy-1,1-bis(hydroxymethyl)-ethyl]carbamate;Carbamic acid, N-[2-hydroxy-1,1-bis(hydroxymethyl)ethyl]-, 1,1-dimethylethyl ester;N-Boc-tris(hydroxymethyl)aminomethane;2-Methyl-2-propanyl [1,3-dihydroxy-2-(hydroxymethyl)-2-propanyl]carbamate;2-(Boc-amino)-2-(hydroxymethyl)propane-1,3-diol;tert-Butyl (1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl)carbamate - [B72437];tert-Butyl (1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl)carbamate | | CAS: | 146651-71-0 | | MF: | C9H19NO5 | | MW: | 221.25 | | EINECS: | | | Product Categories: | | | Mol File: | 146651-71-0.mol | ![tert-Butyl N-[2-hydroxy-1,1-bis(hydroxymethyl)-ethyl]carbamate Structure](CAS/GIF/146651-71-0.gif) |
| | tert-Butyl N-[2-hydroxy-1,1-bis(hydroxymethyl)-ethyl]carbamate Chemical Properties |
| Melting point | 144-146 °C(Solv: tetrahydrofuran (109-99-9)) | | Boiling point | 430.5±45.0 °C(Predicted) | | density | 1+-.0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | Solid | | pka | 10.66±0.46(Predicted) | | InChI | InChI=1S/C9H19NO5/c1-8(2,3)15-7(14)10-9(4-11,5-12)6-13/h11-13H,4-6H2,1-3H3,(H,10,14) | | InChIKey | PYFXOUCQTPUBOG-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NC(CO)(CO)CO |
| | tert-Butyl N-[2-hydroxy-1,1-bis(hydroxymethyl)-ethyl]carbamate Usage And Synthesis |
| Description | N-Boc-Tris contains an acid labile, Boc protecting group. | | Uses | N-Boc-Tris is a protective reagent. N-Boc-Tris can utilize the Boc protecting group to protect amino groups in fields such as organic synthesis and pharmaceutical research and development, thereby avoiding unnecessary side reactions. |
| | tert-Butyl N-[2-hydroxy-1,1-bis(hydroxymethyl)-ethyl]carbamate Preparation Products And Raw materials |
|