| Company Name: |
BioBioPha Co., Ltd.
|
| Tel: |
0871-65217109 13211707573; |
| Email: |
y.liu@mail.biobiopha.com |
| Products Intro: |
Product Name:Protoplumericin A
CAS:80396-57-2
Purity:>97.0% Package:5mg Remarks:BBP02448
|
|
| | ProtopluMericin A Basic information |
| Product Name: | ProtopluMericin A | | Synonyms: | ProtopluMericin A;Protoplumericin;Spiro[cyclopenta[c]pyran-7(1H),2'(5'H)-furan]-4-carboxylic acid, 1-(β-D-glucopyranosyloxy)-4'-[(1S)-1-[[(2E)-3-[4-(β-D-glucopyranosyloxy)phenyl]-1-oxo-2-propen-1-yl]oxy]ethyl]-4a,7a-dihydro-5'-oxo-, methyl ester, (1S,2'R,4aS,7aS)-;methyl(1S,4aS,7R,7aS)-5'-oxo-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4'-[(1S)-1-[(E)-3-[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoyl]oxyethyl]spiro[4a,7a-dihydro-1H-cyclopenta[c]pyran-7,2'-furan]-4-carboxylate | | CAS: | 80396-57-2 | | MF: | C36H42O19 | | MW: | 778.71 | | EINECS: | | | Product Categories: | | | Mol File: | 80396-57-2.mol |  |
| | ProtopluMericin A Chemical Properties |
| Boiling point | 1040.3±65.0 °C(Predicted) | | density | 1.62±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | water: soluble | | form | solid | | pka | 12.77±0.70(Predicted) | | biological source | plant | | Water Solubility | water: soluble | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChIKey | AFYIWKNGSIYXCQ-PYQCQGLYSA-N | | SMILES | O1C(C(C(C(C1CO)O)O)O)O[C@@H]2OC=C([C@@H]3[C@H]2[C@@]4(OC(=O)C(=C4)[C@@H](OC(=O)\C=C\c5ccc(cc5)OC6OC(C(C(C6O)O)O)CO)C)C=C3)C(=O)OC |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | ProtopluMericin A Usage And Synthesis |
| Uses | It is a natural product derived from plant source th at finds application in compound screening libraries, metabolomics, phytochemical, and biochemical research. | | Biological Activity | Protoplumericin A exhibits strong activity against S. aureus. |
| | ProtopluMericin A Preparation Products And Raw materials |
|