|
|
| | tert-butyl (2R)-2-(MethoxyMethyl)piperazine-1-carboxylate Basic information |
| Product Name: | tert-butyl (2R)-2-(MethoxyMethyl)piperazine-1-carboxylate | | Synonyms: | tert-butyl (2R)-2-(MethoxyMethyl)piperazine-1-carboxylate;(R)-1-N-BOC-2-METHOXYMETHYLPIPERAZINE;(R)-tert-Butyl 2-(MethoxyMethyl)piperazine-1-carboxylate;1-Piperazinecarboxylic acid, 2-(MethoxyMethyl)-, 1,1-diMethylethyl ester, (2R)-;(R)-1-Boc-2-(methoxymethyl)piperazine;-tert-Butyl 2-(methoxymethyl);(R)-1-BOC-2-methoxymethylpiperidine;tert-butyl (R)-2-(methoxymethyl)piperazine-1-carboxylate | | CAS: | 1023301-73-6 | | MF: | C11H22N2O3 | | MW: | 230.3 | | EINECS: | | | Product Categories: | | | Mol File: | 1023301-73-6.mol |  |
| | tert-butyl (2R)-2-(MethoxyMethyl)piperazine-1-carboxylate Chemical Properties |
| Boiling point | 300.9±17.0 °C(Predicted) | | density | 1.025±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 8.04±0.40(Predicted) | | Appearance | Colorless to light yellow Liquid | | Optical Rotation | 78.4° (C=0.79 g/100ml MEOH) | | InChI | InChI=1S/C11H22N2O3/c1-11(2,3)16-10(14)13-6-5-12-7-9(13)8-15-4/h9,12H,5-8H2,1-4H3/t9-/m1/s1 | | InChIKey | ODOJNXXZXCRBCC-SECBINFHSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCNC[C@@H]1COC |
| | tert-butyl (2R)-2-(MethoxyMethyl)piperazine-1-carboxylate Usage And Synthesis |
| | tert-butyl (2R)-2-(MethoxyMethyl)piperazine-1-carboxylate Preparation Products And Raw materials |
|