|
|
| | (S)-1-Boc-2-(Hydroxymethyl)piperazine Basic information | | Uses |
| Product Name: | (S)-1-Boc-2-(Hydroxymethyl)piperazine | | Synonyms: | (2S)-2-(Hydroxymethyl)piperazine, N1-BOC protected;tert-Butyl (2S)-2-(hydroxymethyl)piperazine-1-carboxylate, (2S)-1-(tert-Butoxycarbonyl)-2-(hydroxymethyl)piperazine;tert-butyl (S)-2-(hydroxymethyl)piperazine-1-carboxylate;tert-butyl (2S)-2-(hydroxymethyl)piperazine-1-carboxylate;(S)-2-HYDROXYMETHYL-PIPERAZINE-1-CARBOXYLIC ACID TERT-BUTYL ESTER;(S)-1-N-BOC-2-HYDROXYMETHYLPIPERAZINE;1-PIPERAZINECARBOXYLIC ACID, 2-(HYDROXYMETHYL)-, 1,1-DIMETHYLETHYL ESTER, (2S)-;(S)-tert-butyl 2-(hydroxyMethyl)piperazin-1-carboxylate | | CAS: | 1030377-21-9 | | MF: | C10H20N2O3 | | MW: | 216.28 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | (S)-1-Boc-2-(Hydroxymethyl)piperazine Chemical Properties |
| Boiling point | 324℃ | | density | 1.085 | | Fp | 150℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 14.97±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C10H20N2O3/c1-10(2,3)15-9(14)12-5-4-11-6-8(12)7-13/h8,11,13H,4-7H2,1-3H3/t8-/m0/s1 | | InChIKey | BCPPNDHZUPIXJM-QMMMGPOBSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCNC[C@H]1CO |
| | (S)-1-Boc-2-(Hydroxymethyl)piperazine Usage And Synthesis |
| Uses | (S)-1-N-Boc-2-hydroxymethyl piperazine is a heterocyclic compound and can be used as an intermediate in pharmaceutical synthesis. | | Uses | (S)-1-Boc-2-hydroxymethyl-piperazine is a heterocyclic building block used in synthetic chemistry. | | Reactions | (S)-1-Boc-2-(Hydroxymethyl)piperazine reacts with 1,2-difluoro-4-nitrobenzene to synthesize tert-butyl (S)-4-(2-fluoro-4-nitrophenyl)-2-(hydroxymethyl)piperazine-1-carboxylate. This compound serves as a crucial intermediate in the preparation of the Wee-1 kinase activity inhibitor.
 | | Synthesis | To a solution of (S)-4-benzyl 1-tert-butyl 2-(hydroxymethyl)piperazine-1,4-dicarboxylate (1.5 g, 4.28 mmol) in MeOH (20 mL), 10 % Pd/C (150 mg) was added. The mixture was stirred at room temperature for 3 hours under H2. Afterwards, the solid was removed by filtration and the filtrate was concentrated to yield (S)-1-Boc-2-(Hydroxymethyl)piperazine (850 mg, 3.93 mmol, 91.82 percent) as a white solid.
 | | References | [1] Patent: US2018/127370, 2018, A1. Location in patent: Paragraph 1006; 1004 |
| | (S)-1-Boc-2-(Hydroxymethyl)piperazine Preparation Products And Raw materials |
|