| Company Name: |
Beijing Yan Nuo XinCheng Chemical Co., Ltd.
|
| Tel: |
86-10-82830276 |
| Email: |
|
| Products Intro: |
Product Name:N, N,N',N'-tetra-(3-Methylphenyl)-3,3'-diMethylbenzidine
Purity:SubliMed, >99% Package:1g;10g;100g;1kg
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:N,N,N',N'-Tetrakis(3-methylphenyl)-3,3'-dimethylbenzidine
CAS:105465-14-3
Purity:97% (HPLC) Package:5G Remarks:760420-5G
|
| Company Name: |
Shanghai Uchem Inc.
|
| Tel: |
15618758386 15618758386 |
| Email: |
sales3@myuchem.com |
| Products Intro: |
Product Name:N,N,N',N'-Tetrakis(3-methylphenyl)-3,3'-dimethylbenzidine
CAS:105465-14-3
Purity:97% Package:1G;10G;100G
|
| Company Name: |
3A Chemicals
|
| Tel: |
400-668-9898 |
| Email: |
service@3achem.com |
| Products Intro: |
Product Name:N,N,N',N'-Tetra-(3-methylphenyl)-3,3'-dimethylbenzidine
CAS:105465-14-3
Purity:Sublimed, > 99% (HPLC) Package:99999.00RMB/5g Remarks:A69373
|
|
| | N, N,N',N'-tetra-(3-Methylphenyl)-3,3'-diMethylbenzidine Basic information |
| Product Name: | N, N,N',N'-tetra-(3-Methylphenyl)-3,3'-diMethylbenzidine | | Synonyms: | N,N,N′,N′-Tetrakis(3-methylphenyl)-3,3′-dimethylbenzidine;N, N,N',N'-tetra-(3-Methylphenyl)-3,3'-diMethylbenzidine;3,3′-Dimethyl-N4,N4,N4′,N4′-tetra-m-tolyl-[1,1′-biphenyl]-4,4′-diamine;[1,1'-Biphenyl]-4,4'-diamine, 3,3'-dimethyl-N4,N4,N4',N4'-tetrakis(3-methylphenyl)-;N,N,N',N'-Tetrakis(3-methylphenyl)-3,3'-dimethylbenzidine 97% (HPLC);2-Methyl-4-[3-methyl-4-[3-methyl-n-(m-tolyl)anilino]phenyl]-n,n-bis(m-tolyl)aniline;N,N,N',N'-Tetra-(3-methylphenyl)-3,3'-dimethylbenzidine;HMTPD | | CAS: | 105465-14-3 | | MF: | C42H40N2 | | MW: | 572.78 | | EINECS: | | | Product Categories: | | | Mol File: | 105465-14-3.mol |  |
| | N, N,N',N'-tetra-(3-Methylphenyl)-3,3'-diMethylbenzidine Chemical Properties |
| Melting point | 125-133°C | | form | solid | | InChIKey | TZYPEOJJHBWOKE-UHFFFAOYSA-N | | SMILES | Cc1cccc(c1)N(c2cccc(C)c2)c3ccc(cc3C)-c4ccc(N(c5cccc(C)c5)c6cccc(C)c6)c(C)c4 |
| WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | N, N,N',N'-tetra-(3-Methylphenyl)-3,3'-diMethylbenzidine Usage And Synthesis |
| Uses | This material is a novel high performance host material used for Organic Electroluminescent lighting devices for high efficiency and lifetimes. Internal efficiencies of 87% with external efficiencies of 20% were achieved. |
| | N, N,N',N'-tetra-(3-Methylphenyl)-3,3'-diMethylbenzidine Preparation Products And Raw materials |
|