| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
TCI Europe |
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
|
| | Barium bis(trifluoromethanesulfonimide) Basic information |
| | Barium bis(trifluoromethanesulfonimide) Chemical Properties |
| Melting point | >300℃ | | Water Solubility | Soluble in water | | form | Powder | | color | white to off-white | | Sensitive | Moisture Sensitive | | Stability: | hygroscopic | | InChI | 1S/2C2F6NO4S2.Ba/c2*3-1(4,5)14(10,11)9-15(12,13)2(6,7)8;/q2*-1;+2 | | InChIKey | ZFICMXSMTNWQDX-UHFFFAOYSA-N | | SMILES | FC(F)(F)S(=O)(=O)N([Ba]N(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F | | CAS DataBase Reference | 168106-22-7 |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 1759 8 / PGII | | WGK Germany | 3 | | HS Code | 2935.90.9500 | | HazardClass | 8 | | PackingGroup | II | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | Barium bis(trifluoromethanesulfonimide) Usage And Synthesis |
| reaction suitability | core: barium reagent type: catalyst |
| | Barium bis(trifluoromethanesulfonimide) Preparation Products And Raw materials |
|