| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:N,N′-Di-Boc-N-MethylethylenediaMine CAS:105983-83-3 Purity:97% Package:1G,5G
|
tert-Butyl N-[2-(Boc-amino)ethyl]-N-methylcarbamate manufacturers
|
| | tert-Butyl N-[2-(Boc-amino)ethyl]-N-methylcarbamate Basic information |
| | tert-Butyl N-[2-(Boc-amino)ethyl]-N-methylcarbamate Chemical Properties |
| Melting point | 114-119 °C | | Boiling point | 361.9±21.0 °C(Predicted) | | density | 1.030±0.06 g/cm3(Predicted) | | form | solid | | pka | 12.49±0.46(Predicted) | | InChI | 1S/C13H26N2O4/c1-12(2,3)18-10(16)14-8-9-15(7)11(17)19-13(4,5)6/h8-9H2,1-7H3,(H,14,16) | | InChIKey | LDEPHSIHMSDUAS-UHFFFAOYSA-N | | SMILES | CN(CCNC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 1 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | tert-Butyl N-[2-(Boc-amino)ethyl]-N-methylcarbamate Usage And Synthesis |
| | tert-Butyl N-[2-(Boc-amino)ethyl]-N-methylcarbamate Preparation Products And Raw materials |
|