| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
HBCChem, Inc. |
| Tel: |
+1-510-219-6317 |
| Email: |
sales@hbcchem.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Wuxi AppTec |
| Tel: |
022-59987777 13552403979 |
| Email: |
jia_guoqiang@wuxiapptec.com |
|
| | (R)-(-)-1-Benzyloxy-3-(p-tosyloxy)-2-propanol Basic information |
| Product Name: | (R)-(-)-1-Benzyloxy-3-(p-tosyloxy)-2-propanol | | Synonyms: | 1-BENZYL-SN-GLYCEROL 3-TOSYLATE;R(-)-3-BENZYLOXY-1,2-PROPANEDIOL 1-(TOLUENE-4-SULFONATE);R(-)-1-BENZYLOXY-3-TOSYLOXY-2-PROPANOL;(R)-(-)-3-Benzyloxy-1,2-propanediol 1-(p-toluenesulfonate);3-benzyloxy-1,2-propanediol 1-(toluene-4-sulfonate);(R)-(-)-1-Benzyloxy-3-tosyloxy-2-propanol, 1-Benzyl-sn-glycerol 3-tosylate;(R)-(-)-1-Benzyloxy-3-tosyloxy-2-propanol, 1-Benzyl-sn-glycerol 3-tosylate, (R)-(-)-3-Benzyloxy-1,2-propanediol 1-(p-toluenesulfonate);R-1,2-Propanediol-2-Tosylate | | CAS: | 23214-66-6 | | MF: | C17H20O5S | | MW: | 336.4 | | EINECS: | | | Product Categories: | | | Mol File: | 23214-66-6.mol |  |
| | (R)-(-)-1-Benzyloxy-3-(p-tosyloxy)-2-propanol Chemical Properties |
| Melting point | 52-55 °C (lit.) | | alpha | -7 º (C=10 IN TOLUENE) | | Boiling point | 515.6±50.0 °C(Predicted) | | density | 1.253±0.06 g/cm3(Predicted) | | Fp | >230 °F | | storage temp. | 2-8°C | | pka | 12.98±0.20(Predicted) | | Optical Rotation | [α]25/D 7°, c = 10 in toluene | | InChI | 1S/C17H20O5S/c1-14-7-9-17(10-8-14)23(19,20)22-13-16(18)12-21-11-15-5-3-2-4-6-15/h2-10,16,18H,11-13H2,1H3/t16-/m1/s1 | | InChIKey | HBMUWOSOGHUWSS-MRXNPFEDSA-N | | SMILES | Cc1ccc(cc1)S(=O)(=O)OC[C@H](O)COCc2ccccc2 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 3 | | Storage Class | 11 - Combustible Solids |
| | (R)-(-)-1-Benzyloxy-3-(p-tosyloxy)-2-propanol Usage And Synthesis |
| Uses | Reagent employed in enantioselective carbohydrate, terpene, and alkaloid syntheses. | | Uses | (R)-(-)-1-Benzyloxy-3-(p-tosyloxy)-2-propanol is used in the synthesis of Polyhydroxyl Surfactants. |
| | (R)-(-)-1-Benzyloxy-3-(p-tosyloxy)-2-propanol Preparation Products And Raw materials |
|