|
|
| | benzaMide, N-(3,5-dichloro-4-pyridinyl)-4-(difluoroMethoxy)-3-hydroxy- Basic information |
| | benzaMide, N-(3,5-dichloro-4-pyridinyl)-4-(difluoroMethoxy)-3-hydroxy- Chemical Properties |
| Boiling point | 397.4±42.0 °C(Predicted) | | density | 1.593±0.06 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | Soluble in DMSO | | pka | 7.59±0.35(Predicted) | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C13H8Cl2F2N2O3/c14-7-4-18-5-8(15)11(7)19-12(21)6-1-2-10(9(20)3-6)22-13(16)17/h1-5,13,20H,(H,18,19,21) | | InChIKey | GZHTYXYJBZYTEV-UHFFFAOYSA-N | | SMILES | FC(F)Oc1c(cc(cc1)C(=O)N=[c]2c(c[nH]cc2Cl)Cl)O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | benzaMide, N-(3,5-dichloro-4-pyridinyl)-4-(difluoroMethoxy)-3-hydroxy- Usage And Synthesis |
| Uses | O-Decyclopropyl Roflumilast is an impurity of Roflumilast (R639700). |
| | benzaMide, N-(3,5-dichloro-4-pyridinyl)-4-(difluoroMethoxy)-3-hydroxy- Preparation Products And Raw materials |
|