|
|
| | 6-Nitro-1H-indazol-4-carboxylic acid Basic information |
| | 6-Nitro-1H-indazol-4-carboxylic acid Chemical Properties |
| Boiling point | 525.1±35.0 °C(Predicted) | | density | 1.733±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 2.55±0.30(Predicted) | | InChI | 1S/C8H5N3O4/c12-8(13)5-1-4(11(14)15)2-7-6(5)3-9-10-7/h1-3H,(H,9,10)(H,12,13) | | InChIKey | YAHBWBBCYGPFHL-UHFFFAOYSA-N | | SMILES | [N+](=O)([O-])c1cc2[nH]ncc2c(c1)C(=O)O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 6-Nitro-1H-indazol-4-carboxylic acid Usage And Synthesis |
| | 6-Nitro-1H-indazol-4-carboxylic acid Preparation Products And Raw materials |
|